| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | FERRIC TARTRATE Basic information |
| | FERRIC TARTRATE Chemical Properties |
| InChI | 1S/3C4H6O6.2Fe/c3*5-1(3(7)8)2(6)4(9)10;;/h3*1-2,5-6H,(H,7,8)(H,9,10);;/q;;;2*+3/p-6 | | InChIKey | SFOKDWPZOYRZFF-UHFFFAOYSA-H | | SMILES | O=C1[C@H](O)C(O)C(O[Fe](OC(C(O)C(O)C(O[Fe]2OC(C(O)[C@H](O)C(O2)=O)=O)=O)=O)O1)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | FERRIC TARTRATE Usage And Synthesis |
| Uses | Additive used to assess the spinnability of cellulose / alkaline ferric tartrate solutions1 |
| | FERRIC TARTRATE Preparation Products And Raw materials |
|