| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-METHYLPHENANTHRENE Basic information |
| Product Name: | 3-METHYLPHENANTHRENE | | Synonyms: | 3-MethyIphenanthrene;3-METHYLPHENANTHRENE;PHENANTHRENE,3-METHYL-;3-Methylphenanthrene>;3-Methylphenanthrene in isooctane;Trofinetide Impurity 11;METHYLPHENANTHRENE | | CAS: | 832-71-3 | | MF: | C15H12 | | MW: | 192.26 | | EINECS: | 212-623-7 | | Product Categories: | | | Mol File: | 832-71-3.mol |  |
| | 3-METHYLPHENANTHRENE Chemical Properties |
| Melting point | 63 °C | | Boiling point | 370 °C | | density | 1.0561 (estimate) | | refractive index | 1.6031 (estimate) | | form | powder to crystal | | color | White to Almost white | | InChI | InChI=1S/C15H12/c1-11-6-7-13-9-8-12-4-2-3-5-14(12)15(13)10-11/h2-10H,1H3 | | InChIKey | GKYWZUBZZBHZKU-UHFFFAOYSA-N | | SMILES | C1=C2C(C3C(C=C2)=CC=CC=3)=CC(C)=C1 | | EPA Substance Registry System | 3-Methylphenanthrene (832-71-3) |
| | 3-METHYLPHENANTHRENE Usage And Synthesis |
| Uses | 3-Methylphenanthrene is a polycyclic aromatic hydrocarbon that has been found in urban dust particulate matter. | | Synthesis Reference(s) | Journal of the American Chemical Society, 75, p. 1644, 1953 DOI: 10.1021/ja01103a037 |
| | 3-METHYLPHENANTHRENE Preparation Products And Raw materials |
|