| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Diethyl 5,5'-methylenebis(4-ethyl-3-methyl-2-pyrrolecarboxylate) Basic information |
| Product Name: | Diethyl 5,5'-methylenebis(4-ethyl-3-methyl-2-pyrrolecarboxylate) | | Synonyms: | diethyl 5,5'-methylenebis(4-ethyl-3-methyl-2-pyrr;NSC22708;diethyl 5,5'-methylenebis(4-ethyl-3-methyl-2-pyrrolecarbox;1H-Pyrrole-2-carboxylic acid, 5,5'-methylenebis[4-ethyl-3-methyl-, 2,2'-diethyl ester;Diethyl 5,5'-methylenebis(4-ethyl-3-methyl-1h-pyrrole-2-carboxylate);Diethyl 5,5′-methylenebis(4-ethyl-3-methyl-2-pyrrolecarboxylate), CAS 6305-93-7;Diethyl 5,5'-methylenebis(4-ethyl-3-methyl-2-pyrrolecarboxylate) | | CAS: | 6305-93-7 | | MF: | C21H30N2O4 | | MW: | 374.47 | | EINECS: | | | Product Categories: | Building Blocks;Heterocyclic Building Blocks;Pyrroles | | Mol File: | 6305-93-7.mol |  |
| | Diethyl 5,5'-methylenebis(4-ethyl-3-methyl-2-pyrrolecarboxylate) Chemical Properties |
| Melting point | 128-129 °C (lit.) | | Boiling point | 524.6±50.0 °C(Predicted) | | density | 1.126±0.06 g/cm3(Predicted) | | pka | 16.00±0.50(Predicted) | | InChI | 1S/C21H30N2O4/c1-7-14-12(5)18(20(24)26-9-3)22-16(14)11-17-15(8-2)13(6)19(23-17)21(25)27-10-4/h22-23H,7-11H2,1-6H3 | | InChIKey | BPMQEODKNZPRMH-UHFFFAOYSA-N | | SMILES | CCOC(=O)c1[nH]c(Cc2[nH]c(C(=O)OCC)c(C)c2CC)c(CC)c1C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Diethyl 5,5'-methylenebis(4-ethyl-3-methyl-2-pyrrolecarboxylate) Usage And Synthesis |
| Uses | Diethyl 5,5′-methylenebis(4-ethyl-3-methyl-2-pyrrolecarboxylate) may be used as starting reagent for the synthesis of bis-pyrrolylmethane based anion receptors. | | General Description | Diethyl 5,5′-methylenebis(4-ethyl-3-methyl-2-pyrrolecarboxylate) is a heterocyclic building block. |
| | Diethyl 5,5'-methylenebis(4-ethyl-3-methyl-2-pyrrolecarboxylate) Preparation Products And Raw materials |
|