|
|
| | 5'-Hydroxyphenyl carvedilol Basic information |
| | 5'-Hydroxyphenyl carvedilol Chemical Properties |
| Melting point | >182°C (dec.) | | Boiling point | 702.0±60.0 °C(Predicted) | | density | 1.305±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 10.06±0.18(Predicted) | | form | Solid | | color | White to Light Beige | | InChI | 1S/C24H26N2O5/c1-29-21-10-9-16(27)13-23(21)30-12-11-25-14-17(28)15-31-22-8-4-7-20-24(22)18-5-2-3-6-19(18)26-20/h2-10,13,17,25-28H,11-12,14-15H2,1H3 | | InChIKey | PVUVZUBTCLBJMT-UHFFFAOYSA-N | | SMILES | [nH]1c2c(c4c1cccc4)c(ccc2)OCC(O)CNCCOc3c(ccc(c3)O)OC |
| WGK Germany | WGK 3 | | HS Code | 29339900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 STOT RE 2 |
| | 5'-Hydroxyphenyl carvedilol Usage And Synthesis |
| Chemical Properties | Off-White Powder | | Uses | 5'-Hydroxyphenyl Carvedilol is a metabolite of Carvedilol which is a multiple-action, neurohormonal antagonist that is used in the treatment of hypertension. | | Uses | A metabolite of Carvedilol (C184625). It is used in the treatment of hypertension. | | Definition | ChEBI: 5'-Hydroxycarvedilol is a member of carbazoles. |
| | 5'-Hydroxyphenyl carvedilol Preparation Products And Raw materials |
|