| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
|
| | 4-(Methyl-d3-nitrosamino)-1-(3-pyridyl)-1-butanol Basic information |
| Product Name: | 4-(Methyl-d3-nitrosamino)-1-(3-pyridyl)-1-butanol | | Synonyms: | NNAL-METHYL-D3;α-[3-(Methyl-d3-nitrosoaMino)propyl]-;NNAL-D3;alpha-[3-(Methyl-d3-nitrosoamino)propyl]-3-pyridinemethanol;OGRXKBUCZFFSTL-FIBGUPNXSA-N;[2H3]- 4- (Methyl-nitrosamino)-1- (3-pyridyl)-1-butanol;4-(Methyl-d3-nitrosamino)-1-(3-pyridyl)-1-butanol;4-(Methyl-d3-nitrosamino)-1-(3-pyridyl)-1-butanol | | CAS: | 1020719-61-2 | | MF: | C10H12D3N3O2 | | MW: | 212.26 | | EINECS: | | | Product Categories: | Nicotine Derivatives | | Mol File: | Mol File |  |
| | 4-(Methyl-d3-nitrosamino)-1-(3-pyridyl)-1-butanol Chemical Properties |
| storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | Stability: | Stable | | Major Application | cleaning products
cosmetics
food and beverages
personal care | | InChI | 1S/C10H15N3O2/c1-13(12-15)7-3-5-10(14)9-4-2-6-11-8-9/h2,4,6,8,10,14H,3,5,7H2,1H3/i1D3 | | InChIKey | OGRXKBUCZFFSTL-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])N(CCCC(O)c1cccnc1)N=O |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2810 6.1 / PGIII | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 4-(Methyl-d3-nitrosamino)-1-(3-pyridyl)-1-butanol Usage And Synthesis |
| Chemical Properties | Light Yellow Oil | | Uses | A deuterated metabolite of NNK (Cat. #M325750), a tobacco-specific nitrosamine |
| | 4-(Methyl-d3-nitrosamino)-1-(3-pyridyl)-1-butanol Preparation Products And Raw materials |
|