| Company Name: |
chemmole Gold |
| Tel: |
400-168-9330 15013243073 |
| Email: |
597760450@qq.com |
|
| | Oxazine 1 Basic information |
| Product Name: | Oxazine 1 | | Synonyms: | 3,7-bis(diethylamino)-phenoxazin-5-iuperchlorate;3,7-BIS(DIETHYLAMINO)PHENOXAZINIUM PERCHLORATE;3,7-BIS(DIETHYLAMINO)PHENOXAZONIUM PERCHLORATE;3-DIETHYLAMINO-7-DIETHYLIMINOPHENOXAZONIUM PERCHLORATE;OXAZINE 725;OXAZINE 1 PERCHLORATE;3,7-bis(diethylamino)phenoxazin-5-ium perchlorate;3,7-Bis(Diethylamino)phenoxazinum | | CAS: | 24796-94-9 | | MF: | C20H26ClN3O5 | | MW: | 423.89 | | EINECS: | 246-465-5 | | Product Categories: | | | Mol File: | 24796-94-9.mol |  |
| | Oxazine 1 Chemical Properties |
| Melting point | 228-230 °C | | density | 1.2527 (rough estimate) | | refractive index | 1.6500 (estimate) | | storage temp. | Flammables area | | form | Solid | | color | Light green to green | | Appearance | Solid | | InChI | InChI=1S/C20H26N3O.ClHO4/c1-5-22(6-2)15-9-11-17-19(13-15)24-20-14-16(23(7-3)8-4)10-12-18(20)21-17;2-1(3,4)5/h9-14H,5-8H2,1-4H3;(H,2,3,4,5)/q+1;/p-1 | | InChIKey | PKZWDLHLOBYXKV-UHFFFAOYSA-M | | SMILES | C12C=C(C=CC=1N=C1C=C/C(=[N+](\CC)/CC)/C=C1O2)N(CC)CC.Cl([O-])(=O)(=O)=O | | EPA Substance Registry System | Phenoxazin-5-ium, 3,7-bis(diethylamino)-, perchlorate (24796-94-9) |
| Provider | Language |
|
ACROS
| English |
| | Oxazine 1 Usage And Synthesis |
| Description | Rhodulin Pure Blue 3G, also called Oxazine 725, is at present the most important cationic oxazine dye and is represented in all large assortments of polyacrylonitrile dyes. | | Chemical Properties | green crystalline powder | | Uses | Oxazine 1 perchlorate (cas# 24796-94-9) is a compound useful in organic synthesis. | | Definition | ChEBI: Oxazine-1 perchlorate is an organic perchlorate salt. It has a role as a fluorochrome. It contains an oxazine-1. | | Excitation / Emission Maximum | 653 nm/666 nm |
| | Oxazine 1 Preparation Products And Raw materials |
|