|
|
| | [2-(3,5-Dimethyl-1H-pyrazol-1-yl)phenyl]amine Basic information |
| Product Name: | [2-(3,5-Dimethyl-1H-pyrazol-1-yl)phenyl]amine | | Synonyms: | AKOS B029489;2-(3,5-DIMETHYL-PYRAZOL-1-YL)-PHENYLAMINE;ART-CHEM-BB B029489;TIMTEC-BB SBB014842;VITAS-BB TBB010015;2-(3,5-dimethyl-1H-pyrazol-1-yl)aniline(SALTDATA: FREE);Pyrazole, 1-(o-aminophenyl)-3,5-dimethyl- (6CI);Pyrazole,1-(o-aMinophenyl)-3,5-diMethyl- | | CAS: | 60418-47-5 | | MF: | C11H13N3 | | MW: | 187.24 | | EINECS: | | | Product Categories: | | | Mol File: | 60418-47-5.mol | ![[2-(3,5-Dimethyl-1H-pyrazol-1-yl)phenyl]amine Structure](CAS/GIF/60418-47-5.gif) |
| | [2-(3,5-Dimethyl-1H-pyrazol-1-yl)phenyl]amine Chemical Properties |
| Melting point | 92-94℃ | | Boiling point | 332.7±27.0 °C(Predicted) | | density | 1.14±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 2.02±0.10(Predicted) | | form | solid | | Appearance | Light brown to brown Solid | | InChI | 1S/C11H13N3/c1-8-7-9(2)14(13-8)11-6-4-3-5-10(11)12/h3-7H,12H2,1-2H3 | | InChIKey | WPGFYAUWKUKJFK-UHFFFAOYSA-N | | SMILES | NC1=C(C=CC=C1)N(C(C)=C2)N=C2C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | [2-(3,5-Dimethyl-1H-pyrazol-1-yl)phenyl]amine Usage And Synthesis |
| | [2-(3,5-Dimethyl-1H-pyrazol-1-yl)phenyl]amine Preparation Products And Raw materials |
|