1-(Trifluoromethyl)vinyl boronic acid hexylene glycol ester manufacturers
|
| | 1-(Trifluoromethyl)vinyl boronic acid hexylene glycol ester Basic information |
| Product Name: | 1-(Trifluoromethyl)vinyl boronic acid hexylene glycol ester | | Synonyms: | 1-(Trifluoromethyl)vinylboronic acidhexyleneglycol;4,4,6-TRIMETHYL-2-(1-TRIFLUOROMETHYVINYL)-[1,3,2]DIOXABORINANE;1,3,2-Dioxaborinane, 4,4,6-trimethyl-2-[1-(trifluoromethyl)ethenyl]-;6-hydroxyhexyl hydrogen (3,3,3-trifluoroprop-1-en-2-yl)boronate;6-Trimethyl-2-(3;3-trifluoroprop-1-en-2-yl)-1;4,4,6-Trimethyl-2-(3,3,3-trifluoroprop-1-en-2-yl)-1,3,2-dioxaborinane,97%(stabilized with TBC);4,4,6-trimethyl-2-[1-(trifluoromethyl)vinyl]-1,3,2-dioxaborinane - [T70272] | | CAS: | 1011460-68-6 | | MF: | C9H14BF3O2 | | MW: | 222.01 | | EINECS: | 683-061-1 | | Product Categories: | Boronic ester;Organoborons | | Mol File: | 1011460-68-6.mol |  |
| | 1-(Trifluoromethyl)vinyl boronic acid hexylene glycol ester Chemical Properties |
| Boiling point | 185.8±50.0 °C(Predicted) | | density | 1.07±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | liquid | | color | Clear, colourless | | InChI | InChI=1S/C9H14BF3O2/c1-6-5-8(3,4)15-10(14-6)7(2)9(11,12)13/h6H,2,5H2,1,3-4H3 | | InChIKey | GGSSZVWESZQFOZ-UHFFFAOYSA-N | | SMILES | O1C(C)CC(C)(C)OB1C(C(F)(F)F)=C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | Hazard Note | Irritant | | HS Code | 2931900090 |
| | 1-(Trifluoromethyl)vinyl boronic acid hexylene glycol ester Usage And Synthesis |
| Uses | 4,4,6-Trimethyl-2-[1-(trifluoromethyl)ethenyl]-1,3,2-dioxaborinane is derived from Hexylene Glycol (H295870), which is used as a reagent in the synthesis of functionalized boronic ester. Also used in the preparation of vinylboronates. |
| | 1-(Trifluoromethyl)vinyl boronic acid hexylene glycol ester Preparation Products And Raw materials |
|