|
|
| | Cytidine, 2',3'-O-(1-methylethylidene)-, 5'-(2-methylpropanoate) Basic information |
| Product Name: | Cytidine, 2',3'-O-(1-methylethylidene)-, 5'-(2-methylpropanoate) | | Synonyms: | Cytidine, 2',3'-O-(1-methylethylidene)-, 5'-(2-methylpropanoate);2', 3'-O-(1-methylethylidene)-, 5'- (2-methylpropanoate);Molnupiravir N-2;Cytidine,2’,3’-O-(1-methylethtlidene)-,5’-(2-
methylpropanoate);Molnupiravir Impurity 10;Molnupiravir Int.;2′,3′-O-(1-Methylethylidene)-Molnupiravir;Cytidine,2',3'-O-(1-methylethylidene)-,5'-(2-methylpropanoate) | | CAS: | 1686124-74-2 | | MF: | C16H23N3O6 | | MW: | 353.37 | | EINECS: | | | Product Categories: | API | | Mol File: | 1686124-74-2.mol |  |
| | Cytidine, 2',3'-O-(1-methylethylidene)-, 5'-(2-methylpropanoate) Chemical Properties |
| Boiling point | 484.0±55.0 °C(Predicted) | | density | 1.47±0.1 g/cm3(Predicted) | | pka | 4.16±0.10(Predicted) | | InChI | InChI=1S/C16H23N3O6/c1-8(2)14(20)22-7-9-11-12(25-16(3,4)24-11)13(23-9)19-6-5-10(17)18-15(19)21/h5-6,8-9,11-13H,7H2,1-4H3,(H2,17,18,21)/t9-,11-,12-,13-/m1/s1 | | InChIKey | JRJPFXJUVAQYRQ-OJAKKHQRSA-N | | SMILES | C(OC(=O)C(C)C)[C@H]1O[C@@H](N2C=CC(N)=NC2=O)[C@@H]2OC(O[C@H]12)(C)C |
| | Cytidine, 2',3'-O-(1-methylethylidene)-, 5'-(2-methylpropanoate) Usage And Synthesis |
| Uses | 2'',3''-O-(1-Methylethylidene)cytidine 5''-(2-Methylpropanoate) can be used in an improved synthesis of MK-4482 (EIDD-2801) (CAT# E985795) from cytidine as an emerging Covid-19 antiviral agent. |
| | Cytidine, 2',3'-O-(1-methylethylidene)-, 5'-(2-methylpropanoate) Preparation Products And Raw materials |
|