|
|
| | 3-(4-BROMO-PHENYL)-PROPAN-1-OL Basic information |
| Product Name: | 3-(4-BROMO-PHENYL)-PROPAN-1-OL | | Synonyms: | Benzenepropanol, 4-broMo-;3-(4-BroMophenyl)-1-propanol, 98%;3-(4-BROMO-PHENYL)-PROPAN-1-OL;4-Bromobenzenepropanol;3-(4-Bromophenyl)propanol, 98%;3-(4-Bromophenyl)-1-propanol >3-(4-Bromophenyl)-1-propanol,98%;3-(4-Bromophenyl)propyl Alcohol | | CAS: | 25574-11-2 | | MF: | C9H11BrO | | MW: | 215.09 | | EINECS: | 634-788-8 | | Product Categories: | | | Mol File: | 25574-11-2.mol |  |
| | 3-(4-BROMO-PHENYL)-PROPAN-1-OL Chemical Properties |
| Boiling point | 162℃/2.5Torr | | density | 1.41 | | refractive index | 1.5620 to 1.5660 | | storage temp. | Sealed in dry,Room Temperature | | pka | 15.03±0.10(Predicted) | | form | Solid | | color | Colorless to Light yellow | | InChI | InChI=1S/C9H11BrO/c10-9-5-3-8(4-6-9)2-1-7-11/h3-6,11H,1-2,7H2 | | InChIKey | WODKXGCVVOOEIJ-UHFFFAOYSA-N | | SMILES | C1(CCCO)=CC=C(Br)C=C1 |
| HazardClass | IRRITANT | | HS Code | 29062990 |
| | 3-(4-BROMO-PHENYL)-PROPAN-1-OL Usage And Synthesis |
| Chemical Properties | Colorless to pale yellow liquid | | Uses | 3-(4-Bromophenyl)Propan-1-ol is a useful reagent in the synthesis of dimethylmorpholine substituted daphneolone derivatives with fungicidal properties. |
| | 3-(4-BROMO-PHENYL)-PROPAN-1-OL Preparation Products And Raw materials |
|