| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (3,5-Difluoro-2-hydroxy-phenyl)boronic acid Basic information |
| | (3,5-Difluoro-2-hydroxy-phenyl)boronic acid Chemical Properties |
| Boiling point | 318.4±52.0 °C(Predicted) | | density | 1.52±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 6.54±0.58(Predicted) | | Appearance | Off-white to gray Solid | | InChI | InChI=1S/C6H5BF2O3/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,10-12H | | InChIKey | DMZXNOGEVAESIC-UHFFFAOYSA-N | | SMILES | B(C1=CC(F)=CC(F)=C1O)(O)O |
| | (3,5-Difluoro-2-hydroxy-phenyl)boronic acid Usage And Synthesis |
| Uses | 3,5-Difluoro-2-hydroxyphenylboronic acid |
| | (3,5-Difluoro-2-hydroxy-phenyl)boronic acid Preparation Products And Raw materials |
|