| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-(2-(Diethylamino)ethylcarbamoyl)phenylboronic acid, HCl Basic information |
| Product Name: | 4-(2-(Diethylamino)ethylcarbamoyl)phenylboronic acid, HCl | | Synonyms: | 4-[2-(N,N-DIETHYLAMINOETHYL)AMINOCARBONYL]PHENYLBORONIC ACID, HCL;4-[2-(N,N-Diethylaminoethyl)aminocarbonyl]benzeneboronic acid hydrochloride;4-{[2-(Diethylamino)ethyl]carbamoyl}benzeneboronic acid hydrochloride;4-{[2-(Diethylamino)ethyl]carbamoyl}benzeneboronic acid hydrochloride 98%;2-(N,N-DiethylaMinoethyl)aMinocarbonylphenylboronic acid, HCl;(4-((2-(DiethylaMino)ethyl)carbaMoyl)phenyl)boronic acid hydrochloride;4-{[2-(Diethylamino)ethyl]carbamoyl}benzeneboronicacidhydrochloride98%;4-[2-(Diethylamino)ethylaminocarbonyl]phenylboronic acid hydrochloride | | CAS: | 913835-46-8 | | MF: | C13H21BN2O3.ClH | | MW: | 300.59 | | EINECS: | | | Product Categories: | blocks;BoronicAcids | | Mol File: | 913835-46-8.mol |  |
| | 4-(2-(Diethylamino)ethylcarbamoyl)phenylboronic acid, HCl Chemical Properties |
| Melting point | 65-67 | | form | solid | | InChI | 1S/C13H21BN2O3/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(8-6-11)14(18)19/h5-8,18-19H,3-4,9-10H2,1-2H3,(H,15,17) | | InChIKey | DROAKPBJDZLEDM-UHFFFAOYSA-N | | SMILES | O=C(NCCN(CC)CC)C(C=C1)=CC=C1B(O)O |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | 4-(2-(Diethylamino)ethylcarbamoyl)phenylboronic acid, HCl Usage And Synthesis |
| Uses | 4-[2-(N,N-Diethylaminoethyl)aminocarbonyl]phenylboronic acid, HCl |
| | 4-(2-(Diethylamino)ethylcarbamoyl)phenylboronic acid, HCl Preparation Products And Raw materials |
|