|
|
| | 1-(1H-IMIDAZOL-4-YL)-ETHANONE HCL Basic information |
| | 1-(1H-IMIDAZOL-4-YL)-ETHANONE HCL Chemical Properties |
| Melting point | 169-170℃ | | Boiling point | 329.4±15.0 °C(Predicted) | | density | 1.190 | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 11.34±0.10(Predicted) | | form | Solid | | color | White to Light Yellow | | InChI | InChI=1S/C5H6N2O/c1-4(8)5-2-6-3-7-5/h2-3H,1H3,(H,6,7) | | InChIKey | TUFOJIVMBHBZRQ-UHFFFAOYSA-N | | SMILES | C(=O)(C1NC=NC=1)C |
| | 1-(1H-IMIDAZOL-4-YL)-ETHANONE HCL Usage And Synthesis |
| Uses | 1-(1H-imidazol-4-yl)ethanon is a photochemical compound isolated from the essential oil of Mirabilis Jalapa root. |
| | 1-(1H-IMIDAZOL-4-YL)-ETHANONE HCL Preparation Products And Raw materials |
|