|
|
| | 4-Chlorobenzhydrylamine hydrochloride Basic information |
| | 4-Chlorobenzhydrylamine hydrochloride Chemical Properties |
| Melting point | 300-305 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder | | InChI | 1S/C13H12ClN.ClH/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;/h1-9,13H,15H2;1H | | InChIKey | UHPRBUXOILBKFH-UHFFFAOYSA-N | | SMILES | Cl.NC(c1ccccc1)c2ccc(Cl)cc2 | | CAS DataBase Reference | 5267-39-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Chlorobenzhydrylamine hydrochloride Usage And Synthesis |
| | 4-Chlorobenzhydrylamine hydrochloride Preparation Products And Raw materials |
|