|
|
| | 2-Diphenylmethylpiperidine hydrochloride Basic information |
| Product Name: | 2-Diphenylmethylpiperidine hydrochloride | | Synonyms: | 2-(Diphenylmethyl)piperidine hydrochloride;2-Diphenylmethylpiperidine hydrochloride;2-Benzhydryl-piperidine hydrochloride;2-diphenylmethylpyridine hydrochloride;2-benzhydrylpiperidine,2-DPMP HCl;Desoxypipradrol (hydrochloride);Piperidine, 2-(diphenylMethyl)-, hydrochloride (1:1);Desoxypipradrol hydrochloride solution | | CAS: | 5807-81-8 | | MF: | C18H22ClN | | MW: | 287.83 | | EINECS: | 687-988-2 | | Product Categories: | | | Mol File: | 5807-81-8.mol |  |
| | 2-Diphenylmethylpiperidine hydrochloride Chemical Properties |
| Melting point | 287 °C | | Fp | 9℃ | | storage temp. | -20°C | | solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 20 mg/ml; Methanol: 1 mg/ml; PBS (pH 7.2): 10 mg/ml | | form | A crystalline solid | | Major Application | forensics and toxicology | | InChI | 1S/C18H21N.ClH/c1-3-9-15(10-4-1)18(16-11-5-2-6-12-16)17-13-7-8-14-19-17;/h1-6,9-12,17-19H,7-8,13-14H2;1H | | InChIKey | NTADPDIPKMRRQV-UHFFFAOYSA-N | | SMILES | C1(C(C2CCCCN2)C3=CC=CC=C3)=CC=CC=C1.Cl | | CAS DataBase Reference | 5807-81-8(CAS DataBase Reference) |
| Hazard Codes | F,T | | Risk Statements | 11-23/24/25-39/23/24/25 | | Safety Statements | 7-16-36/37-45 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal
Acute Tox. 3 Inhalation
Acute Tox. 3 Oral
Flam. Liq. 2
STOT SE 1 |
| | 2-Diphenylmethylpiperidine hydrochloride Usage And Synthesis |
| Uses | 2-Benzhydrylpiperidine Hydrochloride has been shown to have stimulating activity on the central nervous system. | | General Description | Desoxypipradrol, also referred to as 2-DPMP or 2-diphenylmethylpiperidine, is a stimulant and norepinephrine-dopamine reuptake inhibitor (NDRI). This designer drug, structurally similar to methylphenidate, is sometimes found in certain bath salt blends such as Ivory Wave. This Certified Spiking Solution is suitable as starting material in calibrators and controls for use in LC/MS or GC/MS testing methods in clinical toxicology, urine drug testing, or forensic analysis. |
| | 2-Diphenylmethylpiperidine hydrochloride Preparation Products And Raw materials |
|