| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Fluocortolone Pivalate CAS:29205-06-9 Package:10Mg,1Mg
|
|
| | 6alpha-fluoro-11beta,21-dihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione 21-pivalate Basic information |
| Product Name: | 6alpha-fluoro-11beta,21-dihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione 21-pivalate | | Synonyms: | 6alpha-fluoro-11beta,21-dihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione 21-pivalate;flucortolone pivalate;21-(2,2-Dimethyl-1-oxopropoxy)-6α-fluoro-11β-hydroxy-16α-methylpregna-1,4-diene-3,20-dione;(6α,11β,16α)-21-(2,2-Dimethyl-1-oxopropoxy)-6-fluoro-11-hydroxy-16-methylpregna-1,4-diene-3,20-dione;(6α,11β,16α)-6-Fluoro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-d ien-21-yl pivalate;Fluocortolone pivalate CRS;Pregna-1,4-diene-3,20-dione, 21-(2,2-dimethyl-1-oxopropoxy)-6-fluoro-11-hydroxy-16-methyl-, (6α,11β,16α)-;(6α,11β,16α)-6-Fluoro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-dien-21-ylpivalate | | CAS: | 29205-06-9 | | MF: | C27H37FO5 | | MW: | 460.58 | | EINECS: | 249-504-4 | | Product Categories: | Intermediates & Fine Chemicals;Pharmaceuticals;Steroids;Pharmaceuticals, Intermediates & Fine Chemicals, Steroids | | Mol File: | 29205-06-9.mol |  |
| | 6alpha-fluoro-11beta,21-dihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione 21-pivalate Chemical Properties |
| Melting point | 187 °C | | Boiling point | 572.3±50.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Practically insoluble in water, freely soluble in methylene chloride and in dioxan, sparingly soluble in ethanol (96 per cent). | | pka | 14.05±0.70(Predicted) | | Major Application | pharmaceutical | | InChIKey | XZBJVIQXJHGUBE-HZMVJJPJSA-N | | SMILES | F[C@H]1C[C@@H]2[C@@H]([C@@]4(C1=CC(=O)C=C4)C)[C@H](C[C@]3([C@H]2C[C@H]([C@@H]3C(=O)COC(=O)C(C)(C)C)C)C)O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 6alpha-fluoro-11beta,21-dihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione 21-pivalate Usage And Synthesis |
| Chemical Properties | White or almost white, crystalline powder | | Uses | Fluocortolone Pivalate is a glucocorticoid. | | Definition | ChEBI: Fluocortolone pivalate is a corticosteroid hormone. |
| | 6alpha-fluoro-11beta,21-dihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione 21-pivalate Preparation Products And Raw materials |
|