- β-Tocotrienol
-
- $422.00
-
2026-07-15
- CAS:490-23-3
- Purity:
- Supply Ability: 10g
|
| | D-beta- Tocotrienol Basic information |
| Product Name: | D-beta- Tocotrienol | | Synonyms: | (2R)-3,4-Dihydro-2,5,8-triMethyl-2-[(3E,7E)-4,8,12-triMethyl-3,7,11-tridecatrien-1-yl]-2H-1-benzopyran-6-ol;2,5,8-TriMethyl-2-(4,8,12-triMethyl-3,7,11-
tridecatrienyl)-6-chroManol;D-beta- Tocotrienol;3,4-dihydro-2,5,8-trimethyl-2-(4,8,12-trimethyl-trideca-3,7,11-trienyl)-2H-1-benzopyran-6-ol;tocotrienol, beta;[R-(E,E)]-3,4-Dihydro-2,5,8-trimethyl-2-(4,8,12-trimethyl-3,7,11-tridecatrienyl)-2H-1-benzopyran-6-ol;3,4-Dihydro-2,5,8-trimethyl-2-(4,8,12-trimethyl-3,7,11-tridecatrienyl)-2H-1-benzopyran-6-ol;5-Methyltocol | | CAS: | 490-23-3 | | MF: | C28H42O2 | | MW: | 410.63 | | EINECS: | 207-708-0 | | Product Categories: | Aromatics;Chiral Reagents;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 490-23-3.mol |  |
| | D-beta- Tocotrienol Chemical Properties |
| Melting point | <25℃ | | Boiling point | 528.8±49.0 °C(Predicted) | | density | 0.964±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 10 mg/ml; DMSO: 10 mg/ml; Ethanol: 10 mg/ml | | pka | 11.05±0.40(Predicted) | | form | Liquid | | color | Colorless to light yellow | | biological source | Elaeis guineensis | | Major Application | vitamins, nutraceuticals, and natural products | | InChIKey | FGYKUFVNYVMTAM-WAZJVIJMSA-N | | SMILES | [C@@]1(C)(CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/C)OC2=C(C)C=C(O)C(C)=C2CC1 | | LogP | 10.300 (est) | | EPA Substance Registry System | .epsilon.-Tocopherol (490-23-3) |
| WGK Germany | 2 | | TSCA | TSCA listed | | Storage Class | 10 - Combustible liquids |
| | D-beta- Tocotrienol Usage And Synthesis |
| Uses | β-Tocotrienol is an isomer of Vitamin E. β-Tocotrienol is one of the naturally occurring forms of vitamin E. β-Tocotrienol was isolated from wheat germ oil and from bran. | | Definition | ChEBI: A tocotrienol that is chroman-6-ol substituted by methyl groups at positions 2, 5 and 8 and a farnesyl chain at position 2. It has been isolated from various cultivars of wheat. |
| | D-beta- Tocotrienol Preparation Products And Raw materials |
|