|
|
| | Guanosine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt Basic information |
| Product Name: | Guanosine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt | | Synonyms: | Guanosine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt;2'-Deoxyguanosine 5'-diphosphoric acid α,β-disodium salt;Disodium 2'-deoxyguanosine 5'-diphoshate;Guanosine5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt (9CI);dGDP 100mM Sodium Solution;2'-Deoxyguanosine-5'-diphosphate disodium salt | | CAS: | 78101-74-3 | | MF: | C10H16N5NaO10P2 | | MW: | 451.2 | | EINECS: | 278-836-2 | | Product Categories: | | | Mol File: | 78101-74-3.mol |  |
| | Guanosine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt Chemical Properties |
| solubility | Methanol (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | InChIKey | VLWIICGGBFZYEZ-AALPCHJJNA-N | | SMILES | O=C1NC(N)=NC2N([C@H]3C[C@H](O)[C@@H](COP(O)(=O)OP(O)(O)=O)O3)C=NC1=2.[NaH] |&1:8,10,12,r| |
| | Guanosine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt Usage And Synthesis |
| | Guanosine 5'-(trihydrogen diphosphate), 2'-deoxy-, disodium salt Preparation Products And Raw materials |
|