2-bromopropan-1-ol manufacturers
- 2-bromopropan-1-ol
-
- $1.10 / 1g
-
2025-11-18
- CAS:598-18-5
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | 2-bromopropan-1-ol Basic information |
| Product Name: | 2-bromopropan-1-ol | | Synonyms: | 2-bromopropan-1-ol;2-Bromo-1-propanol;1-Propanol, 2-bromo-(6CI,8CI,9CI);2-bromopropan-1-ol ISO 9001:2015 REACH;2-Bromopropan-1-ol - [B70312] | | CAS: | 598-18-5 | | MF: | C3H7BrO | | MW: | 138.99 | | EINECS: | 209-921-4 | | Product Categories: | | | Mol File: | 598-18-5.mol |  |
| | 2-bromopropan-1-ol Chemical Properties |
| Boiling point | 64-65 °C(Press: 25 Torr) | | density | 1.5551 g/cm3(Temp: 30 °C) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Oil | | pka | 13.89±0.10(Predicted) | | color | Colourless | | InChI | InChI=1S/C3H7BrO/c1-3(4)2-5/h3,5H,2H2,1H3 | | InChIKey | DBTWOTKWIVISQR-UHFFFAOYSA-N | | SMILES | C(O)C(Br)C |
| | 2-bromopropan-1-ol Usage And Synthesis |
| Uses | 2-Bromo-1-propanol is used in the epoxide productions from Flavobacterium. |
| | 2-bromopropan-1-ol Preparation Products And Raw materials |
|