| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
|
| | dibutyl phenyl phosphate Basic information |
| Product Name: | dibutyl phenyl phosphate | | Synonyms: | dibutyl phenyl phosphate;Phosphoric acid, dibutyl phenyl ester;DI-N-BUTYLPHENYLPHOSPHATE;O,O-dibutyl-O-phenylphosphate;Phosphoric acid phenyldibutyl ester;Dibutylphenyl phosphate in isooctane;DBPP | | CAS: | 2528-36-1 | | MF: | C14H23O4P | | MW: | 286.303781 | | EINECS: | 2197727 | | Product Categories: | | | Mol File: | 2528-36-1.mol |  |
| | dibutyl phenyl phosphate Chemical Properties |
| Boiling point | 131-132 °C | | density | 1.0691 g/cm3(Temp: 25 °C) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Slightly yellow liquid | | color | Clear Colourless | | Henry's Law Constant | 2.0×101 mol/(m3Pa) at 25℃, HSDB (2015) | | Exposure limits | PC-TWA: 3.5 mg/m3 | | Stability: | Hygroscopic | | InChI | InChI=1S/C14H23O4P/c1-3-5-12-16-19(15,17-13-6-4-2)18-14-10-8-7-9-11-14/h7-11H,3-6,12-13H2,1-2H3 | | InChIKey | YICSVBJRVMLQNS-UHFFFAOYSA-N | | SMILES | P(OC1=CC=CC=C1)(OCCCC)(OCCCC)=O | | EPA Substance Registry System | Dibutyl phenyl phosphate (2528-36-1) |
| | dibutyl phenyl phosphate Usage And Synthesis |
| Uses | Component in hydraulic fluids | | Uses | Dibutyl Phenyl Phosphate is a phosphorus flame retardant additive. | | General Description | Clear colorless liquid. | | Air & Water Reactions | Insoluble in water. | | Reactivity Profile | Organophosphates, such as dibutyl phenyl phosphate, are susceptible to formation of highly toxic and flammable phosphine gas in the presence of strong reducing agents such as hydrides. Partial oxidation by oxidizing agents may result in the release of toxic phosphorus oxides. | | Health Hazard | Dibutyl phenyl phosphate
(DBPP) has caused skin irritation in humans
after repeated or prolonged contact. | | Fire Hazard | dibutyl phenyl phosphate is probably combustible. | | Safety Profile | Moderately toxic by
ingestion. Experimental reproductive
effects. When heated to decomposition it
emits toxic fumes of POx. |
| | dibutyl phenyl phosphate Preparation Products And Raw materials |
|