| Company Name: |
Hu Bei Jiutian Bio-medical Technology CO.,Ltd |
| Tel: |
027-88013699 17354350817 |
| Email: |
Ryan@jiutian-bio.com |
| Products Intro: |
Product Name:3-methyl-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione
CAS:81818-54-4
Purity:0.99 Package:25kg,50kg,180kg,200kg,250kg,1000kg,as your needs Remarks:as your needs
|
|
|
|
|
|
| | 2-methyl-3-(3,7,11,15-tetramethylhexadec-2-enyl)-1,4-naphthoquinone Basic information | | Application |
| Product Name: | 2-methyl-3-(3,7,11,15-tetramethylhexadec-2-enyl)-1,4-naphthoquinone | | Synonyms: | 2-methyl-3-(3,7,11,15-tetramethylhexadec-2-enyl)-1,4-naphthoquinone;Einecs 279-833-9;Dry Vitamin K1 5% SD;Vitamin K1 (
Phytomenadione);3-methyl-2-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione;Phytonadione Impurity 32;1,4-Naphthalenedione, 2-methyl-3-(3,7,11,15-tetramethyl-2-hexadecen-1-yl)-;2-Methyl-3-(3,7,11,15-tetramethylhexadec-2-en-1-yl)naphthalene-1,4-dione | | CAS: | 81818-54-4 | | MF: | C31H46O2 | | MW: | 450.7 | | EINECS: | 279-833-9 | | Product Categories: | | | Mol File: | 81818-54-4.mol |  |
| | 2-methyl-3-(3,7,11,15-tetramethylhexadec-2-enyl)-1,4-naphthoquinone Chemical Properties |
| Boiling point | 546.4±50.0 °C(Predicted) | | density | 0.963±0.06 g/cm3(Predicted) | | Cosmetics Ingredients Functions | SKIN CONDITIONING - MISCELLANEOUS | | InChI | InChI=1S/C31H46O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)20-21-27-26(6)30(32)28-18-7-8-19-29(28)31(27)33/h7-8,18-20,22-24H,9-17,21H2,1-6H3 | | InChIKey | MBWXNTAXLNYFJB-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C(CC=C(C)CCCC(C)CCCC(C)CCCC(C)C)=C1C |
| | 2-methyl-3-(3,7,11,15-tetramethylhexadec-2-enyl)-1,4-naphthoquinone Usage And Synthesis |
| Application | Vitamin K1 is used clinically for the prevention and treatment of hypothrombin syndrome, vitamin K1 deficiency, neonatal spontaneous hemorrhage, as well as bleeding caused by obstructive jaundice, bile fistula, chronic diarrhea, etc., and hypoprothrombinemia caused by coumarins, sodium salicylate, etc. | | Chemical Properties | Vitamin K-1 is a yellow to orange transparent viscous liquid, odorless or almost odorless; easily decomposed when exposed to light. It is soluble in chloroform, ether or vegetable oil, slightly soluble in ethanol and insoluble in water. | | Definition | ChEBI: 2-methyl-3-(3,7,11,15-tetramethylhexadec-2-enyl)naphthalene-1,4-dione is a member of 1,4-naphthoquinones. |
| | 2-methyl-3-(3,7,11,15-tetramethylhexadec-2-enyl)-1,4-naphthoquinone Preparation Products And Raw materials |
|