|
|
| | 3-(4-Trifluoromethylphenyl)propenal Basic information |
| Product Name: | 3-(4-Trifluoromethylphenyl)propenal | | Synonyms: | 3-(4-Trifluoromethylphenyl)propenal;4-(TRIFLUOROMETHYL)CINNAMALDEHYDE;3-(4-Trifluoromethylphenyl)-2-propenal;2-Propenal, 3-[4-(trifluoroMethyl)phenyl]-;3-(4-(TrifluoroMethyl)phenyl)acrylaldehyde;P-trifluoromethyl cinnamaldehyde | | CAS: | 41917-83-3 | | MF: | C10H7F3O | | MW: | 200.16 | | EINECS: | | | Product Categories: | | | Mol File: | 41917-83-3.mol |  |
| | 3-(4-Trifluoromethylphenyl)propenal Chemical Properties |
| Boiling point | 247℃ | | density | 1.241 | | Fp | 104℃ | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | Appearance | White to yellow Solid | | InChI | InChI=1S/C10H7F3O/c11-10(12,13)9-5-3-8(4-6-9)2-1-7-14/h1-7H | | InChIKey | HYCDCKWWJCPUNT-UHFFFAOYSA-N | | SMILES | C(=O)C=CC1=CC=C(C(F)(F)F)C=C1 |
| | 3-(4-Trifluoromethylphenyl)propenal Usage And Synthesis |
| | 3-(4-Trifluoromethylphenyl)propenal Preparation Products And Raw materials |
|