|
|
| | 4-(Trifluoromethyl)phenylacetic acid Basic information |
| | 4-(Trifluoromethyl)phenylacetic acid Chemical Properties |
| Melting point | 82-85 °C(lit.) | | Boiling point | 203°C (rough estimate) | | density | 1.2815 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.01±0.10(Predicted) | | form | Crystals or Crystalline Powder | | color | White to very pale yellow | | BRN | 2267687 | | InChI | 1S/C9H7F3O2/c10-9(11,12)7-3-1-6(2-4-7)5-8(13)14/h1-4H,5H2,(H,13,14) | | InChIKey | HNORVZDAANCHAY-UHFFFAOYSA-N | | SMILES | OC(=O)Cc1ccc(cc1)C(F)(F)F | | CAS DataBase Reference | 32857-62-8(CAS DataBase Reference) | | NIST Chemistry Reference | («ALPHA»,«alpha»,«alpha»-trifluoro-p-tolyl)-acetic acid(32857-62-8) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(Trifluoromethyl)phenylacetic acid Usage And Synthesis |
| Chemical Properties | white to very pale yellow crystals or | | Uses | 4-(Trifluoromethyl)benzeneacetic Acid is an intermediate used to synthesize PPARγ/δ dual agonists via solid-Phase parallel synthesis. It was also used to prepare heterocyclic xanthine derivatives as highly potent and selective human A2B adenosine receptor antagonists. | | General Description | 4-(Trifluoromethyl)phenylacetic acid undergoes diolefination mediated by mono-N-protected amino acid ligands in the presence of ethyl acrylate, Pd(OAc)2, KHCO3 and t-amyl alcohol. |
| | 4-(Trifluoromethyl)phenylacetic acid Preparation Products And Raw materials |
|