| Company Name: |
Zhengzhou Acme Chemical Co., Ltd. Gold
|
| Tel: |
0371-037163312495,13303845143 13303845143 |
| Email: |
3001379618@qq.com |
| Products Intro: |
Product Name:TRICAPRYLYL CITRATE
Purity:99% Package:500g;1kg;5kg;10kg;25kg;100kg;200kg
|
| Company Name: |
Shandong Xiya Chemical Co., Ltd.
|
| Tel: |
4009903999 13395398332 |
| Email: |
sales@xiyashiji.com |
| Products Intro: |
Purity:试剂级 Package:5g;25g;100g;250g;500g;1kg
|
| Company Name: |
Nantong Runfeng Petrochemical Co., Ltd
|
| Tel: |
0513-66017690 19952660367 |
| Email: |
2143087160@qq.com |
| Products Intro: |
Product Name:Trioctyl citrate
Purity:99% HPLC Package:1KG;25KG;50KG;200KG
|
|
| | TRICAPRYLYL CITRATE Basic information |
| | TRICAPRYLYL CITRATE Chemical Properties |
| Cosmetics Ingredients Functions | SKIN CONDITIONING
SKIN CONDITIONING - EMOLLIENT | | InChI | InChI=1S/C30H56O7/c1-4-7-10-13-16-19-22-35-27(31)25-30(34,29(33)37-24-21-18-15-12-9-6-3)26-28(32)36-23-20-17-14-11-8-5-2/h34H,4-26H2,1-3H3 | | InChIKey | APVVRLGIFCYZHJ-UHFFFAOYSA-N | | SMILES | C(OCCCCCCCC)(=O)CC(CC(OCCCCCCCC)=O)(C(OCCCCCCCC)=O)O |
| | TRICAPRYLYL CITRATE Usage And Synthesis |
| Uses | tricaprylyl citrate is an emollient and skin conditioner. |
| | TRICAPRYLYL CITRATE Preparation Products And Raw materials |
|