| Identification | Back Directory | [Name]
(S)-Methyl-2-Boc-AMino-4-pentenoic acid | [CAS]
89985-87-5 | [Synonyms]
Boc-L-Gly(Ally)-OMe Boc-Allylglycine methyl ester Methyl (S)-2-(Boc-amino)-4-pentenoate (S)-Methyl-2-Boc-AMino-4-pentenoic acid (2S)-2-(Boc-amino)-4-pentenoic acid methyl ester (S)-Methyl 2-(tert-butoxycarbonylamino)-pent-4-enoate tert-butyl (S)-1-(methoxycarbonyl)but-3-enylcarbamate methyl (2S)-2-(tert-butoxycarbonylamino)pent-4-enoate 4-Pentenoic acid, 2-[[(1,1-diMethylethoxy)carbonyl]aMino]-, Methylester, (2S)- | [Molecular Formula]
C11H19NO4 | [MDL Number]
MFCD13190790 | [MOL File]
89985-87-5.mol | [Molecular Weight]
229.27 |
| Chemical Properties | Back Directory | [Boiling point ]
302.0±35.0 °C(Predicted) | [density ]
1.035±0.06 g/cm3(Predicted) | [storage temp. ]
2-8°C | [pka]
11.08±0.46(Predicted) | [Appearance]
Colorless to light yellow Liquid | [Optical Rotation]
Consistent with structure | [InChI]
InChI=1S/C11H19NO4/c1-6-7-8(9(13)15-5)12-10(14)16-11(2,3)4/h6,8H,1,7H2,2-5H3,(H,12,14)/t8-/m0/s1 | [InChIKey]
APXWRHACXBILLH-QMMMGPOBSA-N | [SMILES]
C(OC)(=O)[C@@H](NC(OC(C)(C)C)=O)CC=C |
|
|