Pyridine, 5-bromo-2-(difluoromethyl)-
|
|
|
- CAS-Nr.
- 845827-13-6
- Englisch Name:
- Pyridine, 5-bromo-2-(difluoromethyl)-
- Synonyma:
- 3-Bromo-6-(difluoromethyl)pyridine;Pyridine, 5-bromo-2-(difluoromethyl)-;5-Bromo-2-(difluoromethyl)pyridine 95%;5-Bromo-alpha,alpha-difluoro-2-picoline
- CBNumber:
- CB02468671
- Summenformel:
- C6H4BrF2N
- Molgewicht:
- 208
- MOL-Datei:
- 845827-13-6.mol
|
Pyridine, 5-bromo-2-(difluoromethyl)- Eigenschaften
- Schmelzpunkt:
- 35-40℃
- Siedepunkt:
- 206.6±35.0 °C(Predicted)
- Dichte
- 1.64
- Flammpunkt:
- 89°(192°F)
- storage temp.
- 2-8°C
- Aggregatzustand
- Solid
- pka
- -0.83±0.29(Predicted)
- Farbe
- White to yellow
- InChI
- InChI=1S/C6H4BrF2N/c7-4-1-2-5(6(8)9)10-3-4/h1-3,6H
- InChIKey
- QXLZRIGSWWQOLG-UHFFFAOYSA-N
- SMILES
- C1(C(F)F)=NC=C(Br)C=C1
- CAS Datenbank
- 845827-13-6
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| Kennzeichnung gefährlicher |
T |
|
|
| R-Sätze: |
25-36/37/38 |
|
|
| S-Sätze: |
26-45 |
|
|
| RIDADR |
2811 |
|
|
| WGK Germany |
3 |
|
|
| HazardClass |
6.1 |
|
|
| PackingGroup |
Ⅲ |
|
|
| HS Code |
2933399990 |
|
|
| Speicherklasse |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|
|
| Hazard Classifications |
Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Achtung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H301 |
Giftig bei Verschlucken. |
Akute Toxizität oral |
Kategorie 3 |
Achtung |
 |
P264, P270, P301+P310, P321, P330,P405, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizität (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P302+P352 |
BEI BERÜHRUNG MIT DER HAUT: Mit viel Wasser/... (Hersteller kann, falls zweckmäßig, ein Reinigungsmittel angeben oder, wenn Wasser eindeutig ungeeignet ist, ein alternatives Mittel empfehlen) waschen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter spülen. |
|
Pyridine, 5-bromo-2-(difluoromethyl)- Chemische Eigenschaften,Einsatz,Produktion Methoden
Pyridine, 5-bromo-2-(difluoromethyl)- Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
Pyridine, 5-bromo-2-(difluoromethyl)- Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 92)Lieferanten
- 5-Bromo-alpha,alpha-difluoro-2-picoline
- 3-Bromo-6-(difluoromethyl)pyridine
- 5-Bromo-2-(difluoromethyl)pyridine 95%
- Pyridine, 5-bromo-2-(difluoromethyl)-
- 845827-13-6