3-Fluoro-4-nitroanisole
|
|
|
- CAS-Nr.
- 446-38-8
- Englisch Name:
- 3-Fluoro-4-nitroanisole
- Synonyma:
- 2-Fluoro-4-methoxy-1-nitrobenzene;3-FLUORO-4-NITROANISOLE;Anisole, 3-fluoro-4-nitro-;3-Fluoro-4-nitroanisole 98%;2-Fluoro-4-methoxynitrobenzene;3-Fluor-4-nitrophenylmethylether;Benzene, 2-fluoro-4-methoxy-1-nitro-;2-FLUORO-4-(METHOXY-D3)-1-NITROBENZENE;5-Fluoro3-Fluoro-4-nitroanisole-2-nitrotoluene;2-Fluoro-4-methoxynitrobenzene[3-Fluoro-4-nitroanisole
- CBNumber:
- CB0678203
- Summenformel:
- C7H6FNO3
- Molgewicht:
- 171.13
- MOL-Datei:
- 446-38-8.mol
|
3-Fluoro-4-nitroanisole Eigenschaften
- Schmelzpunkt:
- 57.3
- Siedepunkt:
- 264.5±20.0 °C(Predicted)
- Dichte
- 1.321±0.06 g/cm3(Predicted)
- storage temp.
- Sealed in dry,2-8°C
- Aggregatzustand
- crystalline solid
- Farbe
- Off-white
- InChI
- InChI=1S/C7H6FNO3/c1-12-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3
- InChIKey
- PLEJCMKVJYUUBA-UHFFFAOYSA-N
- SMILES
- C1([N+]([O-])=O)=CC=C(OC)C=C1F
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| Kennzeichnung gefährlicher |
Xi,C |
|
|
| R-Sätze: |
34 |
|
|
| S-Sätze: |
26-36/37/39-45 |
|
|
| RIDADR |
3261 |
|
|
| WGK Germany |
WGK 3 |
|
|
| Hazard Note |
Irritant/Keep Cold |
|
|
| HazardClass |
8 |
|
|
| PackingGroup |
Ⅱ |
|
|
| HS Code |
2909309090 |
|
|
| Speicherklasse |
8A - Combustible corrosive hazardous materials |
|
|
| Hazard Classifications |
Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H317 |
Kann allergische Hautreaktionen verursachen. |
Sensibilisierung der Haut |
Kategorie 1A |
Warnung |
 |
P261, P272, P280, P302+P352,P333+P313, P321, P363, P501 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
|
| Sicherheit |
| P280 |
Schutzhandschuhe/Schutzkleidung/Augenschutz tragen. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter spülen. |
|
3-Fluoro-4-nitroanisole Chemische Eigenschaften,Einsatz,Produktion Methoden
Verwenden
3-Fluoro-4-nitroanisole is synthesizing new antiseptic-germicide, sterilant, and the important organic fluoride-containing intermediate of liquid crystal material.
3-Fluoro-4-nitroanisole Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
3-Fluoro-4-nitroanisole Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 221)Lieferanten
446-38-8()Verwandte Suche:
- 3-FLUORO-4-NITROANISOLE
- 2-Fluoro-4-methoxynitrobenzene
- 2-Fluoro-4-methoxynitrobenzene, 3-Fluoro-4-nitrophenyl methyl ether
- 3-Fluoro-4-nitroanisole 98%
- Anisole, 3-fluoro-4-nitro-
- Benzene, 2-fluoro-4-methoxy-1-nitro-
- 3-Fluor-4-nitrophenylmethylether
- 2-FLUORO-4-(METHOXY-D3)-1-NITROBENZENE
- 2-Fluoro-4-methoxynitrobenzene[3-Fluoro-4-nitroanisole
- 5-Fluoro3-Fluoro-4-nitroanisole-2-nitrotoluene
- 2-Fluoro-4-methoxy-1-nitrobenzene
- 446-38-8
- blocks
- FluoroCompounds
- NitroCompounds
- Aromatic Halides (substituted)
- K00001