D-Galacturonic acid
|
|
|
- CAS-Nr.
- 14984-39-5
- Englisch Name:
- D-Galacturonic acid
- Synonyma:
- D-(+)-Galacturonic sodium salt;D-(+)-Galacturonic acid (sodium);D-Galacturonic acid sodium salt;D-Galacturonic acid,monosodium salt (9CI);D-Galacturonic acid sodiuM salt >=98.0% (T);D-Galacturonic acid sodium salt >=95.0% (T);(4S)-3,4,5,6-tetrahydroxyoxane-2-carboxylate;Sodium (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate
- CBNumber:
- CB6497231
- Summenformel:
- C6H11NaO7
- Molgewicht:
- 218.14
- MOL-Datei:
- 14984-39-5.mol
|
D-Galacturonic acid Eigenschaften
- Aggregatzustand
- Powder
- Farbe
- White to Off-white
- Biologische Quelle
- plant
- Optische Rotation
- [α]/D +36.5±2°, 5 hr, c = 10% in H2O
- Sensitive
- Hygroscopic
- InChI
- 1S/C6H10O7.Na/c7-1-2(8)4(5(10)11)13-6(12)3(1)9;/h1-4,6-9,12H,(H,10,11);/q;+1/p-1/t1-,2+,3+,4-,6;/m0./s1
- InChIKey
- MSXHSNHNTORCAW-KSSASCOMSA-M
- SMILES
- [Na+].OC1O[C@@H]([C@H](O)[C@H](O)[C@H]1O)C([O-])=O
Sicherheit
- Risiko- und Sicherheitserklärung
- Gefahreninformationscode (GHS)
| WGK Germany |
3 |
|
|
| F |
3-10 |
|
|
| Speicherklasse |
11 - Combustible Solids |
|
|
| Bildanzeige (GHS) |
|
| Alarmwort |
Warnung
|
| Gefahrenhinweise |
| Code |
Gefahrenhinweise |
Gefahrenklasse |
Abteilung |
Alarmwort |
Symbol |
P-Code |
| H302 |
Gesundheitsschädlich bei Verschlucken. |
Akute Toxizität oral |
Kategorie 4 |
Warnung |
 |
P264, P270, P301+P312, P330, P501 |
| H315 |
Verursacht Hautreizungen. |
Hautreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P302+P352, P321,P332+P313, P362 |
| H319 |
Verursacht schwere Augenreizung. |
Schwere Augenreizung |
Kategorie 2 |
Warnung |
 |
P264, P280, P305+P351+P338,P337+P313P |
| H335 |
Kann die Atemwege reizen. |
Spezifische Zielorgan-Toxizität (einmalige Exposition) |
Kategorie 3 (Atemwegsreizung) |
Warnung |
 |
|
|
| Sicherheit |
| P261 |
Einatmen von Staub vermeiden. |
| P305+P351+P338 |
BEI KONTAKT MIT DEN AUGEN: Einige Minuten lang behutsam mit Wasser spülen. Eventuell vorhandene Kontaktlinsen nach Möglichkeit entfernen. Weiter spülen. |
|
D-Galacturonic acid Chemische Eigenschaften,Einsatz,Produktion Methoden
D-Galacturonic acid Upstream-Materialien And Downstream Produkte
Upstream-Materialien
Downstream Produkte
D-Galacturonic acid Anbieter Lieferant Produzent Hersteller Vertrieb Händler.
Global( 57)Lieferanten
14984-39-5()Verwandte Suche:
- D-Galacturonic acid,monosodium salt (9CI)
- D-Galacturonic acid sodium salt >=95.0% (T)
- D-(+)-Galacturonic sodium salt
- D-Galacturonic acid sodiuM salt >=98.0% (T)
- (4S)-3,4,5,6-tetrahydroxyoxane-2-carboxylate
- D-(+)-Galacturonic acid (sodium)
- D-Galacturonic acid sodium salt
- Sodium (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate
- 14984-39-5
- Carbohydrates
- Carbohydrates A to
- Carbohydrates GBiochemicals and Reagents
- MonosaccharideSpecialty Synthesis
- Carbohydrate Synthesis
- Monosaccharides
- Specialty Synthesis