2-Benzyl-2-thiopseudourea hydrochloride
2-Benzyl-2-thiopseudourea hydrochloride 속성
- 녹는점
- 172-177 °C
- 저장 조건
- Inert atmosphere,Room Temperature
- 용해도
- 메탄올: 가용성 1g/10mL, 투명, 무색 내지 매우 희미한 노란색
- 물리적 상태
- powder to crystal
- 색상
- 하얀색
- 수용성
- 250g/L(15℃)
- 감도
- Hygroscopic
- Merck
- 14,1146
- BRN
- 3656719
- InChI
- InChI=1S/C8H10N2S.ClH/c9-8(10)11-6-7-4-2-1-3-5-7;/h1-5H,6H2,(H3,9,10);1H
- InChIKey
- WJAASTDRAAMYNK-UHFFFAOYSA-N
- SMILES
- C1(C=CC=CC=1)CSC(=N)N.Cl
- CAS 데이터베이스
- 538-28-3(CAS DataBase Reference)
- EPA
- Carbamimidothioic acid, phenylmethyl ester, monohydrochloride (538-28-3)
안전
- 위험 및 안전 성명
- 위험 및 사전주의 사항 (GHS)
| 위험품 표기 |
T |
|
|
| 위험 카페고리 넘버 |
25 |
|
|
| 안전지침서 |
36/37/39-45-28A |
|
|
| 유엔번호(UN No.) |
UN 2811 6.1/PG 2 |
|
|
| WGK 독일 |
3 |
|
|
| RTECS 번호 |
UM0738000 |
|
|
| TSCA |
Yes |
|
|
| 위험 등급 |
6.1 |
|
|
| 포장분류 |
II |
|
|
| HS 번호 |
29309070 |
|
|
| 독성 |
LD50 oral in rat: 27mg/kg |
|
|
| 그림문자(GHS): |
|
| 신호 어: |
Danger |
| 유해·위험 문구: |
| 암호 |
유해·위험 문구 |
위험 등급 |
범주 |
신호 어 |
그림 문자 |
P- 코드 |
| H300 |
삼키면 치명적임 |
급성 독성 물질 - 경구 |
구분 1,2 |
위험 |
|
P264, P270, P301+P310, P321, P330,P405, P501 |
|
| 예방조치문구: |
| P264 |
취급 후에는 손을 철저히 씻으시오. |
| P264 |
취급 후에는 손을 철저히 씻으시오. |
| P301+P310 |
삼켰다면 즉시 의료기관(의사)의 진찰을 받으시오. |
|
| NFPA 704 |
|
|
|
2-Benzyl-2-thiopseudourea hydrochloride C화학적 특성, 용도, 생산
화학적 성질
off-white to light beige crystalline powder
용도
Reagent for cobalt and nickel; identification and separation of carboxylic, sulfinic, and sulfonic acid.
일반 설명
S-benzylisothiourea analogs (2-benzyl-2-thiopseudourea hydrochloride), as small-molecule inhibitors of indoleamine-2,3-dioxygenase, has been studied.
Safety Profile
Poison by ingestion,intraperitoneal, subcutaneous, and intravenous routes.When heated to decomposition it emits very toxic fumesof HCl, SOx, and NOx.
Purification Methods
Crystallise the chloride from 0.2M HCl (2mL/g) or EtOH and it dry in air. [Beilstein 6 III 1600.]
2-Benzyl-2-thiopseudourea hydrochloride 준비 용품 및 원자재
원자재
준비 용품
2-Benzyl-2-thiopseudourea hydrochloride 공급 업체
글로벌( 173)공급 업체
2-Benzyl-2-thiopseudourea hydrochloride 관련 검색:
