시클로프로필-카르밤산페닐에스테르
|
|
시클로프로필-카르밤산페닐에스테르 속성
- 끓는 점
- 265.0±13.0 °C(Predicted)
- 밀도
- 1.19±0.1 g/cm3(Predicted)
- 산도 계수 (pKa)
- 11.24±0.20(Predicted)
- InChI
- InChI=1S/C10H11NO2/c12-10(11-8-6-7-8)13-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H,11,12)
- InChIKey
- MGIODZWPWVYAOR-UHFFFAOYSA-N
- SMILES
- C(OC1=CC=CC=C1)(=O)NC1CC1
안전
- 위험 및 안전 성명
- 위험 및 사전주의 사항 (GHS)
| 그림문자(GHS): |
|
|||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 신호 어: | Warning | |||||||||||||||||||||||||||||||||||
| 유해·위험 문구: |
|
|||||||||||||||||||||||||||||||||||
| 예방조치문구: |
|
시클로프로필-카르밤산페닐에스테르 C화학적 특성, 용도, 생산
용도
Phenyl?N-cyclopropylcarbamate is used for the preparation of aminopyrimidine-piperazinecarboxamide compounds as JAK2 inhibitors useful in the treatment of malignant blood diseases or other proliferative diseases.시클로프로필-카르밤산페닐에스테르 준비 용품 및 원자재
원자재
준비 용품
시클로프로필-카르밤산페닐에스테르 공급 업체
글로벌( 28)공급 업체
| 공급자 | 전화 | 이메일 | 국가 | 제품 수 | 이점 |
|---|---|---|---|---|---|
| Guangzhou Tosun Pharmaceutical Ltd | +86-020-61855200-902 +8618124244216 |
info@upharm.cn | China | 897 | 58 |
| ANHUI WITOP BIOTECH CO., LTD | +8615255079626 |
eric@witopchemical.com | China | 23541 | 58 |
| QUALITY CONTROL SOLUTIONS LTD. | +86-0755-66853366 +86-13670046396 |
export03@qcsrm.com | China | 24342 | 58 |
| Xinyi Guangbang Medical Technology Co., Ltd. | 13361936468 |
410756539@qq.com | China | 308 | 58 |
| S.Z. PhyStandard Bio-Tech. Co., Ltd. | 0755-4000505016 13380397412 |
3001272453@qq.com | China | 5158 | 50 |
| ChemStrong Scientific Co.,Ltd | 0755-0755-66853366 13670046396 |
sales@chem-strong.com | China | 18298 | 56 |
| Shanghai Kewel Chemical Co., Ltd. | 021-64609169 18901607656 |
greensnown@163.com | China | 9906 | 50 |
| Guangzhou Dreampharm Biotechnology Co., Ltd. | 020-36607679 19925672674 |
3008233746@qq.com | China | 9882 | 12 |
| Yangzhou Changhua Biotechnology Co., Ltd. | 15189846850 13815846020 |
710163098@qq.com | China | 908 | 58 |
| Jinan blalong chemical co. LTD | 2710913286@.com |
1513643261@qq.com | China | 14246 | 58 |