| Company Name: |
Wuhan Hongde Yuexin Pharmatech Co.,Ltd
|
| Tel: |
027-83855393 15827063722 |
| Email: |
3306264753@qq.com |
| Products Intro: |
Cas:143-24-8
ProductName:tetraglyme
Purity: 98% | Package: 1kg;5kg;10kg;25kg
|
| Company Name: |
Wuhan xinyangruihe Chemical Technology Co., Ltd.
|
| Tel: |
153-07155313 15307155313 |
| Email: |
2274366233@qq.com |
| Products Intro: |
Cas:143-24-8
ProductName:Tetraglyme; 1-methoxy-2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethane
Purity: 99% | Package: 1KG;25KG;200KG
|
| Company Name: |
Toronto Research Chemicals Inc.
|
| Tel: |
+1 (416) 665-9696 |
| Email: |
info@trc-canada.com |
| Products Intro: |
Cas:143-24-8
ProductName:Tetraglyme
Brand:trc-canada | Product Number:T292995
|
|
| | Tetraglyme Basic information |
| Product Name: | Tetraglyme | | Synonyms: | TETRA(ETHYLENE GLYCOL) DIMETHYL ETHER, 9 9+%;TETRAETHYLENE GLYCOL DIMETHYL ETHER,STAN DARD FOR GC;Tetraethylene glycol dimethyl ether, 98+%;2,5,8,11,14-Pentaoxapentadecane, Bis[2-(2-methoxyethoxy)ethyl] ether, Dimethoxytetraethylene glycol, Dimethyltetraglycol, Tetraglyme;Tetraethylene glycol dimethyl ether, 99%, extra pure;Tetraethylene glycol dimethyl ether, extra pure;1-(2-methoxyethoxy)-2-[2-(2-methoxyethoxy)-ethoxy]-ethane;1,11-dimethoxy-3,6,9-trioxa-undecane | | CAS: | 143-24-8 | | MF: | C10H22O5 | | MW: | 222.28 | | EINECS: | 205-594-7 | | Product Categories: | Aliphatics;Alkyl;Biomaterials;Crosslinking Agents;Homobifunctional PEGs;Materials Science;Poly(ethylene glycol) and Poly(ethylene oxide);Polymer Science;Polymers;Building Blocks;C10;Chemical Synthesis;Ethers;Organic Building Blocks;Oxygen Compounds | | Mol File: | 143-24-8.mol |  |
| | Tetraglyme Chemical Properties |
| Melting point | -30 °C (lit.) | | Boiling point | 275-276 °C (lit.) | | density | 1.009 g/mL at 25 °C (lit.) | | vapor density | 7.7 (vs air) | | vapor pressure | <0.01 mm Hg ( 20 °C) | | refractive index | n20/D 1.432(lit.) | | Fp | 285 °F | | storage temp. | Store below +30°C. | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Liquid | | Specific Gravity | 1.01 | | color | Clear | | explosive limit | 0.8%(V) | | Water Solubility | Soluble | | Merck | 14,9208 | | BRN | 1760005 | | Major Application | environmental | | InChI | 1S/C10H22O5/c1-11-3-5-13-7-9-15-10-8-14-6-4-12-2/h3-10H2,1-2H3 | | InChIKey | ZUHZGEOKBKGPSW-UHFFFAOYSA-N | | SMILES | COCCOCCOCCOCCOC | | LogP | -0.84 at 23℃ | | Surface tension | 33.74mN/m at 298.15K | | CAS DataBase Reference | 143-24-8(CAS DataBase Reference) | | NIST Chemistry Reference | CH3O[CH2CH2O]4CH3(143-24-8) | | EPA Substance Registry System | Tetraglyme (143-24-8) |
| Hazard Codes | Xi | | Risk Statements | 19-43-62-61 | | Safety Statements | 36-24-45-36/37-53-26 | | WGK Germany | 1 | | RTECS | SB0400000 | | Autoignition Temperature | 510 °F | | TSCA | TSCA listed | | HS Code | 2909 19 90 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B | | Toxicity | LD50 orally in rats: 5.14 g/kg (Smyth) |
| | Tetraglyme Usage And Synthesis |
| Description | Tetraglyme is a widely used family of saturated polyethers for increasing anion reactivity in a given system, thus affecting selectivity and reaction rates. It is one of the heavier ethylene oxide based glymes available commercially.
| | Characteristics | Tetraglyme is a polar aprotic solvent with excellent chemical and thermal stability.
| | Uses | Tetraglyme's high boiling point and stability makes it an ideal candidate for separation processes and high temperature reactions. TEGDME is also used in lithium-ion battery technology and combined with trifluoroethanol as a working pair for organic absorption heat pumps.
| | Safety | Tetraglyme is listed as a Substance of Very High Concern under REACH regulations.
|
| | Tetraglyme Preparation Products And Raw materials |
|