(S,S)-2,2'-Methylenebis(4-tert-butyl-2-oxazoline) manufacturers
|
| | (S,S)-2,2'-Methylenebis(4-tert-butyl-2-oxazoline) Basic information |
| Product Name: | (S,S)-2,2'-Methylenebis(4-tert-butyl-2-oxazoline) | | Synonyms: | 2,2'-Methylenebis[(4S)-4-tert-butyl-4,5-dihydro-2-oxazole];Bis((4S)-4-tert-butyl-4,5-dihydrooxazol-2-yl)methane;bis((S)-4-(tert-butyl)-4,5-dihydrooxazol-2-yl)methane;(4S,4'S)-2,2'-methylenebis[4-(1,1-dimethylethyl)-4,5-dihydro-Oxazole;Oxazole, 2,2'-methylenebis[4-(1,1-dimethylethyl)-4,5-dihydro-, (4S,4'S)-;Bis[(S)-4-(tert-butyl)-4,5-dihydro-2-oxazolyl]methane;2,2′-Methylenebis[(4S)-4-tert-butyl-2-oxazoline];(S,S)-2,2'-Methylenebis(4-tert-butyl-2-oxazoline) | | CAS: | 132098-54-5 | | MF: | C15H26N2O2 | | MW: | 266.38 | | EINECS: | | | Product Categories: | | | Mol File: | 132098-54-5.mol |  |
| | (S,S)-2,2'-Methylenebis(4-tert-butyl-2-oxazoline) Chemical Properties |
| Melting point | 51-53 °C(lit.) | | Boiling point | 328.8±25.0 °C(Predicted) | | density | 1.08±0.1 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 5.39±0.70(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D 118°, c = 0.5 in chloroform | | BRN | 4190673 | | InChI | InChI=1S/C15H26N2O2/c1-14(2,3)10-8-18-12(16-10)7-13-17-11(9-19-13)15(4,5)6/h10-11H,7-9H2,1-6H3/t10-,11-/m1/s1 | | InChIKey | WCCCBUXURHZPQL-GHMZBOCLSA-N | | SMILES | C(C1=N[C@@H](C(C)(C)C)CO1)C1=N[C@@H](C(C)(C)C)CO1 |
| | (S,S)-2,2'-Methylenebis(4-tert-butyl-2-oxazoline) Usage And Synthesis |
| Uses | C2 symmetric ligand for enantioselective catalysis. Easily forms bidentate coordination complexes due to the strong affinity of the oxazoline nitrogen for various metals. |
| | (S,S)-2,2'-Methylenebis(4-tert-butyl-2-oxazoline) Preparation Products And Raw materials |
|