|
|
| | 4-(1H-1,2,4-Triazol-1-ylmethyl)benzonitrile Basic information |
| Product Name: | 4-(1H-1,2,4-Triazol-1-ylmethyl)benzonitrile | | Synonyms: | 4-(1H-1,2,4-TRIAZOL-1-YLMETHYL)BENZONITRILE;4-(1H-1,2,4-TRIAZOLYLMETHYL)BENZONITRILE;4-1-(1,2,4-Triazolyl)-methyl-benzonitril;4-[1-(1,2,4-triazolyl)-methyl]-benzonitrile ( For Letrozole );4-[1-(1,2,4-triazolyl)-methyl-benzonitrile;4-((1H-1,2,4-triazol-1-yl)methyl)benzonitrile (intermediate of letrozole);4-(1H-1,2,4-Triazol-1-ylmethyl)benzonitrile 97%;4-[1-(4-CYANOPHENYL)-HYDROXYMETHYL]-BENZONITRILE | | CAS: | 112809-25-3 | | MF: | C10H8N4 | | MW: | 184.2 | | EINECS: | | | Product Categories: | Phenyls & Phenyl-Het;Aromatics;Heterocycles;Phenyls & Phenyl-Het;Nitriles;(intermediate of letrozole);Aromatics Compounds;Intermediate of Letrozole | | Mol File: | 112809-25-3.mol |  |
| | 4-(1H-1,2,4-Triazol-1-ylmethyl)benzonitrile Chemical Properties |
| Melting point | 69 °C | | Boiling point | 412.1±55.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 2.52±0.10(Predicted) | | color | White | | InChI | InChI=1S/C10H8N4/c11-5-9-1-3-10(4-2-9)6-14-8-12-7-13-14/h1-4,7-8H,6H2 | | InChIKey | HQLYWHSJALKYOV-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(CN2C=NC=N2)C=C1 | | CAS DataBase Reference | 112809-25-3(CAS DataBase Reference) |
| | 4-(1H-1,2,4-Triazol-1-ylmethyl)benzonitrile Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | 4-(1H-1,2,4-Triazol-1-ylmethyl)benzonitrile is an intermediate in the synthesis of Letrozole (L330100), an antineoplastic. |
| | 4-(1H-1,2,4-Triazol-1-ylmethyl)benzonitrile Preparation Products And Raw materials |
|