AC-LYS(AC)-D-ALA-D-ALA-OH manufacturers
|
| | AC-LYS(AC)-D-ALA-D-ALA-OH Basic information |
| | AC-LYS(AC)-D-ALA-D-ALA-OH Chemical Properties |
| Boiling point | 840.0±65.0 °C(Predicted) | | density | 1.193±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | water: 50 mg/mL, clear, colorless | | pka | 3.43±0.10(Predicted) | | form | powder | | Water Solubility | water: 50mg/mL, clear, colorless | | InChI | 1S/C16H28N4O6/c1-9(14(23)19-10(2)16(25)26)18-15(24)13(20-12(4)22)7-5-6-8-17-11(3)21/h9-10,13H,5-8H2,1-4H3,(H,17,21)(H,18,24)(H,19,23)(H,20,22)(H,25,26) | | InChIKey | VIHGYLJIMMKSBR-UHFFFAOYSA-N | | SMILES | OC([C@@H](C)NC([C@@H](C)NC([C@@H](NC(C)=O)CCCCNC(C)=O)=O)=O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | AC-LYS(AC)-D-ALA-D-ALA-OH Usage And Synthesis |
| Uses | Substrate for penicillin-sensitive D-alanine carboxypeptidase. | | Definition | ChEBI: (Ac)2-L-Lys-D-Ala-D-Ala is a peptide. |
| | AC-LYS(AC)-D-ALA-D-ALA-OH Preparation Products And Raw materials |
|