3-Ethynylbicyclo[4.2.0]octa-1(6),2,4-triene manufacturers
|
| | 3-Ethynylbicyclo[4.2.0]octa-1(6),2,4-triene Basic information |
| Product Name: | 3-Ethynylbicyclo[4.2.0]octa-1(6),2,4-triene | | Synonyms: | 1-(cyclobut-1-en-1-ylMethyl)-4-ethynylbenzene;3-Ethynyl-bicyclo[4.2.0]octa-1(6),2,4-triene;Bicyclo[4.2.0]octa-1,3,5-triene, 3-ethynyl- (9CI);4-Ethynylbenzocyclobutene;Bicyclo[4.2.0]octa-1,3,5-triene, 3-ethynyl- | | CAS: | 144597-22-8 | | MF: | C10H8 | | MW: | 128.17 | | EINECS: | | | Product Categories: | | | Mol File: | 144597-22-8.mol | ![3-Ethynylbicyclo[4.2.0]octa-1(6),2,4-triene Structure](CAS/GIF/144597-22-8.gif) |
| | 3-Ethynylbicyclo[4.2.0]octa-1(6),2,4-triene Chemical Properties |
| Boiling point | 209.9±29.0 °C(Predicted) | | density | 1.05±0.1 g/cm3(Predicted) | | vapor pressure | 0.3±0.2 mmHg at 25°C | | refractive index | 1.594 | | Fp | 68.1±18.4 °C | | storage temp. | 2-8°C | | InChI | InChI=1S/C10H8/c1-2-8-3-4-9-5-6-10(9)7-8/h1,3-4,7H,5-6H2 | | InChIKey | UDJGDXMIUPGDCM-UHFFFAOYSA-N | | SMILES | C12C(CC1)=CC=C(C#C)C=2 | | LogP | 2.96 |
| | 3-Ethynylbicyclo[4.2.0]octa-1(6),2,4-triene Usage And Synthesis |
| Uses | 3-Ethynylbicyclo[4.2.0]octa-1(6),2,4-triene can be used as a polymer monomer for the preparation of polymers used to fabricate low-dielectric-constant insulating layers in microelectronic devices. |
| | 3-Ethynylbicyclo[4.2.0]octa-1(6),2,4-triene Preparation Products And Raw materials |
|