(2S)-3-(4-Bromothiazol-2-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid manufacturers
|
| | (2S)-3-(4-Bromothiazol-2-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid Basic information | | Uses |
| | (2S)-3-(4-Bromothiazol-2-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid Chemical Properties |
| Boiling point | 487.8±45.0 °C(Predicted) | | density | 1.543±0.06 g/cm3(Predicted) | | storage temp. | RT, protect from light | | pka | 3.41±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1/C11H15BrN2O4S/c1-11(2,3)18-10(17)13-6(9(15)16)4-8-14-7(12)5-19-8/h5-6H,4H2,1-3H3,(H,13,17)(H,15,16)/t6-/s3 | | InChIKey | LUCLYJDULYUBBG-ISZMHOAENA-N | | SMILES | C(C1SC=C(Br)N=1)[C@@H](C(=O)O)NC(=O)OC(C)(C)C |&1:7,r| |
| | (2S)-3-(4-Bromothiazol-2-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid Usage And Synthesis |
| Uses | (2S)-3-(4-Bromothiazol-2-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid can be used as a pharmaceutical intermediate for the preparation of Ras inhibitors and other anticancer drugs. |
| | (2S)-3-(4-Bromothiazol-2-yl)-2-((tert-butoxycarbonyl)amino)propanoic acid Preparation Products And Raw materials |
|