| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | Trimethylphloroglucinol Basic information |
| Product Name: | Trimethylphloroglucinol | | Synonyms: | 2,4,6-Mesitylenetriol;2,4,6-Trimethyl-1,3,5-benzenetriol;2,4,6-TrihydroxyMesitylene;2,4,6-TriMethyl-1,3,5-benzenetriol triMethylphloroglucinol;2,4,6-triMethylbenzene-1,3,5-triol;1,3,5-Benzenetriol, 2,4,6-trimethyl-;TRIMETHYLPHLOROGLUCINAL;Trimethyl Phloroglucino | | CAS: | 4463-03-0 | | MF: | C9H12O3 | | MW: | 168.19 | | EINECS: | | | Product Categories: | Aromatics;Intermediates & Fine Chemicals;Pharmaceuticals | | Mol File: | 4463-03-0.mol |  |
| | Trimethylphloroglucinol Chemical Properties |
| Melting point | 184-185 °C | | Boiling point | 327.3±37.0 °C(Predicted) | | density | 1.259±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly), DCM | | form | Solid | | pka | 10.09±0.33(Predicted) | | color | White to Orange | | InChI | InChI=1S/C9H12O3/c1-4-7(10)5(2)9(12)6(3)8(4)11/h10-12H,1-3H3 | | InChIKey | MNBSXKSWDLYJHN-UHFFFAOYSA-N | | SMILES | C1(O)=C(C)C(O)=C(C)C(O)=C1C |
| | Trimethylphloroglucinol Usage And Synthesis |
| Description | Trimethylphloroglucinol is a chemical compound that has been used for pharmaceutical preparations to treat inflammatory bowel disease. It has been shown to have anti-inflammatory effects and may act as an antioxidant. It also acts as a glycol ether, which can cause allergic reactions in some people. It is a trifluoromethanesulfonic acid salt that can be used for drug repositioning or wastewater treatment. | | Chemical Properties | Pale Orange Solid | | Uses | Phloroglucinol derivative used to reduce the pain intensity of irritable bowel syndrome. Antispasmodic agent. It is also used before the hysteroscopic surgery as a means to efficaciously soften the cervix. | | Uses | TriMethylphloroglucinol is used to reduce the pain intensity of irritable bowel syndrome,it is a kind of antispasmodic agent. It is also used before the hysteroscopic surgery as a means to efficaciously soften the cervix. |
| | Trimethylphloroglucinol Preparation Products And Raw materials |
|