| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 3-Bromo-2,6-difluoroaniline Basic information |
| Product Name: | 3-Bromo-2,6-difluoroaniline | | Synonyms: | 3-BroMo-2,6-difluoroaniline, 96%;Benzenamine, 3-bromo-2,6-difluoro-;3-Bromo-2,6-difluoroaniline,96%;3-BroMo-2,6-difluoroaniline, 96% ISO 9001：2015 REACH;3-Bromo-2,6-difluorobenzenamine;3-Bromo-2,6-difluoroaniline | | CAS: | 1262198-07-1 | | MF: | C6H4BrF2N | | MW: | 208 | | EINECS: | | | Product Categories: | | | Mol File: | 1262198-07-1.mol |  |
| | 3-Bromo-2,6-difluoroaniline Chemical Properties |
| Boiling point | 203.6±35.0 °C(Predicted) | | density | 1.788±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 0.74±0.10(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C6H4BrF2N/c7-3-1-2-4(8)6(10)5(3)9/h1-2H,10H2 | | InChIKey | HIZADWSSPWORHH-UHFFFAOYSA-N | | SMILES | C1(N)=C(F)C=CC(Br)=C1F | | CAS DataBase Reference | 1262198-07-1 |
| HazardClass | 6.1 | | HS Code | 2921420090 |
| | 3-Bromo-2,6-difluoroaniline Usage And Synthesis |
| Uses | 3-Bromo-2,6-difluoroaniline is a halogenated aniline compound with fluorine and bromine functional groups on its benzene ring, which can be used in organic synthesis or chemical reaction reagents. | | Chemical Reactivity | The structure of 3-Bromo-2,6-difluoroaniline allows for selective functionalization, making it valuable in creating active ingredients with high efficacy and specificity. Also employed in the production of dyes and fluorescent compounds due to its electron-withdrawing halogen groups, which enhance photostability and optical properties. Commonly utilized in research for constructing complex organic molecules through cross-coupling reactions. |
| | 3-Bromo-2,6-difluoroaniline Preparation Products And Raw materials |
|