|
|
| | 2-Nitro 5-bromo-benzaldehyde Basic information |
| Product Name: | 2-Nitro 5-bromo-benzaldehyde | | Synonyms: | Benzaldehyde, 5-broMo-2-nitro-;5-BROMO-2-NITRO-BENZALDEHYDE;CU48750000;5-Bromo-2-nitrobenzaldehyde >2-Nitro 5-Bromo-Benzaldehyde,>97%;5-Bromo-2-nitrobenzaL;2-Nitro 5-bromo-benzaldehyde | | CAS: | 20357-20-4 | | MF: | C7H4BrNO3 | | MW: | 230.02 | | EINECS: | | | Product Categories: | | | Mol File: | 20357-20-4.mol |  |
| | 2-Nitro 5-bromo-benzaldehyde Chemical Properties |
| Melting point | 71.0 to 75.0 °C | | Boiling point | 330.5±27.0 °C(Predicted) | | density | 1.781±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Light red to Green | | λmax | 276nm(CH3CN)(lit.) | | InChI | InChI=1S/C7H4BrNO3/c8-6-1-2-7(9(11)12)5(3-6)4-10/h1-4H | | InChIKey | UFRVBZVJVRHSNR-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC(Br)=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 20357-20-4 |
| Risk Statements | 43 | | Safety Statements | 36/37 | | RTECS | CU4875000 | | HS Code | 2913000090 | | Toxicity | mouse,LD50,intravenous,32mg/kg (32mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#07008, |
| | 2-Nitro 5-bromo-benzaldehyde Usage And Synthesis |
| Uses | 2-Bromo-5-nitrobenzaldehyde is a cholesteryl ester transfer protein (CETP) inhibitor. 2-Bromo-5-nitrobenzaldehyde is a commonly used reactant for the synthesis of (-)-Linarinic acid derivatives as neuroprotective agents against oxygen glucose deprivation (OGD)-induced cell damage. | | Synthesis | 1. Concentrated nitric acid (10 mL) is slowly added dropwise to a solution of concentrated sulfuric acid (120 mL) containing 3-bromobenzaldehyde (11.7 mL, 100 mmol) at 5°C. The reaction system is allowed to come to room temperature with continuous stirring overnight.
2. The reaction system was allowed to warm naturally to room temperature with continuous stirring overnight.
3. The reaction mixture was slowly poured into ice water and the resulting precipitate was collected by filtration. 4.
4. The precipitate was dissolved in dichloromethane, dried by adding anhydrous magnesium sulfate, and the solvent was subsequently concentrated under reduced pressure.
5. The crude product was purified by fast column chromatography on silica gel with 25% ethyl acetate/isohexane as eluent to afford the target compound 5-bromo-2-nitrobenzaldehyde (16g, 70% yield).
6. The product NMR hydrogen spectral data (500 MHz, CDCl3): δ 10.41 (1H, s), 8.06 (1H, d, J = 2.1 Hz), 8.02 (1H, d, J = 8.6 Hz), 7.87 (1H, dd, J = 2.1,8.6 Hz). | | References | [1] Chemistry - A European Journal, 2013, vol. 19, # 7, p. 2442 - 2449 [2] Patent: CN105669566, 2016, A. Location in patent: Paragraph 0027; 0028; 0029; 0030; 0031 [3] Journal of Organic Chemistry, 2014, vol. 79, # 17, p. 7822 - 7830 [4] Organic and Biomolecular Chemistry, 2018, vol. 16, # 33, p. 6115 - 6122 [5] Patent: WO2006/100519, 2006, A1. Location in patent: Page/Page column 16-17 |
| | 2-Nitro 5-bromo-benzaldehyde Preparation Products And Raw materials |
|