O-Desmethyl Quinidine manufacturers
|
| | O-Desmethyl Quinidine Basic information |
| | O-Desmethyl Quinidine Chemical Properties |
| Melting point | 186-190 °C | | Boiling point | 514.6±45.0 °C(Predicted) | | density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.82±0.40(Predicted) | | color | Pale Yellow to Light Yellow | | Optical Rotation | 253.108° (C=0.01 g/ml, ETOH) | | InChI | InChI=1S/C19H22N2O2/c1-2-12-11-21-8-6-13(12)9-18(21)19(23)15-5-7-20-17-4-3-14(22)10-16(15)17/h2-5,7,10,12-13,18-19,22-23H,1,6,8-9,11H2/t12-,13-,18+,19-/m0/s1 | | InChIKey | VJFMSYZSFUWQPZ-WXPXUSHHSA-N | | SMILES | [C@@H](O)([C@@H]1[N@]2CC[C@H]([C@H](C2)C=C)C1)C1=CC=NC2=CC=C(O)C=C12 |
| | O-Desmethyl Quinidine Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | A metabolite of Quinidine. |
| | O-Desmethyl Quinidine Preparation Products And Raw materials |
|