|
|
| | O-Desmethyl Quinine Basic information |
| | O-Desmethyl Quinine Chemical Properties |
| Melting point | >171°C (dec.) | | alpha | D17 -176° | | Boiling point | 450.55°C (rough estimate) | | density | 1.1396 (rough estimate) | | refractive index | 1.5600 (estimate) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 6.57(at 25℃) | | form | Solid | | color | Off-White to Pale Yellow | | InChI | InChI=1/C19H22N2O2/c1-2-12-11-21-8-6-13(12)9-18(21)19(23)15-5-7-20-17-4-3-14(22)10-16(15)17/h2-5,7,10,12-13,18-19,22-23H,1,6,8-9,11H2/t12-,13+,18+,19-/s3 | | InChIKey | VJFMSYZSFUWQPZ-HQKGGXQFNA-N | | SMILES | N12CC[C@@]([C@H](C=C)C1)([H])C[C@@]2([H])[C@H](O)C1=CC=NC2C=CC(O)=CC1=2 |&1:3,4,10,12,r| |
| | O-Desmethyl Quinine Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | A metabolite of Quinine (Q694000). | | Definition | One of the cinchona alkaloids. | | Purification Methods | Cupreine crystallises from EtOH (anhydrous crystals) and wet Et2O (as dihydrate crystals). It has Kb 2.7x10-7 [Kolthoff Biochem Z 162 323]. The sulfate forms needles, m 257o(dec), from MeOH, amyl alcohol or H2O, with [] 20-197.9o (c 1.2, H2O). [Beilstein 22 I 165, 22 II 416.] |
| | O-Desmethyl Quinine Preparation Products And Raw materials |
|