| Company Name: |
SIMAGCHEM CORP |
| Tel: |
+86-5922680277 +86-13806087780 |
| Email: |
sale@simagchem.com |
|
| | 2,4,5-Trimethoxynitrobenzene
Basic information |
| | 2,4,5-Trimethoxynitrobenzene
Chemical Properties |
| Melting point | 130 °C | | Boiling point | 357.3±37.0 °C(Predicted) | | density | 1.230±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | InChI | InChI=1S/C9H11NO5/c1-13-7-5-9(15-3)8(14-2)4-6(7)10(11)12/h4-5H,1-3H3 | | InChIKey | SXVFZZZETDRISD-UHFFFAOYSA-N | | SMILES | C1(OC)=CC([N+]([O-])=O)=C(OC)C=C1OC |
| | 2,4,5-Trimethoxynitrobenzene
Usage And Synthesis |
| Chemical Properties | Yellow needle-shaped crystals (ethanol). Melting point 130℃. | | Uses | 1,2,4-Trimethoxy-5-nitrobenzene is used in the synthesis of streptonigrone via one-step construction of substituted pyridones and Conrad-Limpach reaction. |
| | 2,4,5-Trimethoxynitrobenzene
Preparation Products And Raw materials |
|