| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
5-Methacrylamidoisophthalic acid manufacturers
- MS 15203
-
- $38.00
-
2026-07-15
- CAS:73912-52-4
- Purity: 99.53%
- Supply Ability: 10g
|
| | 5-Methacrylamidoisophthalic acid Basic information |
| Product Name: | 5-Methacrylamidoisophthalic acid | | Synonyms: | MS 15203;5-[(2-Methyl-1-oxo-2-propen-1-yl)amino]-1,3-benzenedicarboxylic acid;CHEMBRDG-BB 5186719;5-(METHACRYLOYLAMINO)ISOPHTHALIC ACID;5-(methacryloylamino)isophthalic acid(SALTDATA: FREE);MS0015203 >=98% (HPLC);5-Methacrylamidoisophthalic acid;1,3-Benzenedicarboxylic acid, 5-[(2-methyl-1-oxo-2-propen-1-yl)amino]- | | CAS: | 73912-52-4 | | MF: | C12H11NO5 | | MW: | 249.22 | | EINECS: | | | Product Categories: | | | Mol File: | 73912-52-4.mol |  |
| | 5-Methacrylamidoisophthalic acid Chemical Properties |
| Melting point | 297 °C(Solv: ethanol (64-17-5); water (7732-18-5)) | | Boiling point | 561.3±50.0 °C(Predicted) | | density | 1.420±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | pka | 3.36±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | 1S/C12H11NO5/c1-6(2)10(14)13-9-4-7(11(15)16)3-8(5-9)12(17)18/h3-5H,1H2,2H3,(H,13,14)(H,15,16)(H,17,18) | | InChIKey | NVOBVSWSDYFEMR-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CC(C(O)=O)=CC(NC(C(C)=C)=O)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| | 5-Methacrylamidoisophthalic acid Usage And Synthesis |
| Uses | MS 15203. is a potent and selective agonist of the neuropeptide receptor GPR171. It has also been shown to increases neuronal activity in the paraventricular nucleus, and to ncrease food intake and body weight in mice. | | Biological Activity | MS0015203 is a potent and selective agonist of the neuropeptide receptor GPR171. MS0015203 increases food intake and body weight in mice. | | in vivo | MS15203 (MS0015203) (3 mg/kg; i.p.) causes an increase in neuronal activity within cells containing GPR171 in the PVN[1].
. MS15203 (3 mg/kg; i.p.) significantly increases food intake at 4 and 8 hours[1].
MS15203 (3 mg/kg; i.p.) significantly increases the abundance of the mRNAs encoding proSAAS, NPY, AgRP[1]. | | storage | Store at -20°C |
| | 5-Methacrylamidoisophthalic acid Preparation Products And Raw materials |
|