|
|
| | 2-Acrylamide-2-methylpropanesulfonic acid Basic information |
| | 2-Acrylamide-2-methylpropanesulfonic acid Chemical Properties |
| Melting point | 195 °C (dec.) (lit.) | | density | 1.45 | | bulk density | 640kg/m3 | | vapor pressure | <0.0000004 hPa (25 °C) | | refractive index | 1.6370 (estimate) | | Fp | 160 °C | | storage temp. | Store below +30°C. | | solubility | >500g/l soluble | | pka | 1.67±0.50(Predicted) | | form | solution | | color | White | | Water Solubility | 1500 g/L (20 ºC) | | Sensitive | Hygroscopic | | BRN | 1946464 | | Stability: | Light Sensitive | | InChI | 1S/C7H13NO4S/c1-4-6(9)8-7(2,3)5-13(10,11)12/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12) | | InChIKey | HNKOEEKIRDEWRG-UHFFFAOYSA-N | | SMILES | CC(C)(CS(O)(=O)=O)NC(=O)C=C | | LogP | -3.7 at 20℃ and pH1-7 | | Surface tension | 70.5mN/m at 1g/L and 20℃ | | Dissociation constant | 2.4 at 20℃ | | CAS DataBase Reference | 15214-89-8(CAS DataBase Reference) | | EPA Substance Registry System | 1-Propanesulfonic acid, 2-methyl-2-[(1-oxo-2-propenyl)amino]- (15214-89-8) |
| Hazard Codes | C,Xn | | Risk Statements | 34-21/22-41-37-20/22 | | Safety Statements | 26-36/37/39-45-22 | | RIDADR | UN 2585 8/PG 3 | | WGK Germany | 1 | | RTECS | TZ6658000 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29241900 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 STOT SE 3 | | Toxicity | LD50 orally in Rabbit: 1000 - 2000 mg/kg |
| | 2-Acrylamide-2-methylpropanesulfonic acid Usage And Synthesis |
| Chemical Properties | 2-Acrylamide-2-methylpropanesulfonic acid is a white crystals. The melting point is 195°C (decomposition). Soluble in water, the solution is acidic. Soluble in dimethylformamide, partially soluble in methanol, ethanol, insoluble in acetone. Slightly sour. | | Uses | 2-Acrylamide-2-methylpropanesulfonic acid has good complexion, adsorption, biological activity, surface activity, hydrolysis stability and thermal stability. It can be used in oil chemical, water treatment, synthetic fiber, printing and dyeing, plastics, water absorbing coatings, paper, bio-medical, magnetic materials and cosmetics industries. | | Preparation | 2-Acrylamido-2-methylpropanesulfonic acid(AMPS) can be synthesized by one step and two steps. The one-step method is to react the raw materials acrylonitrile, isobutylene and oleum together. The two-step method is to sulfonate isobutylene in the presence of a reaction solvent to obtain a sulfonated intermediate, and then react with acrylonitrile in the presence of sulfuric acid. One-step method is more economical. Raw material consumption quota: isobutylene 300kg/t, acrylonitrile 290kg/t, oleum 560kg/t. | | Application | 2-Acrylamide-2-methylpropanesulfonic acid is an important monomer. Its copolymers or homopolymers with different molecular weight can be widely used in textile, oil drilling, water treatment, papermaking, dying, coating, cosmetics, electronics, etc. because of its unique formular structure—containing sulfonic acid group and unsaturated radical, thus showing excellent properties in many aspects. | | Definition | ChEBI: 2-Methyl-2-[(1-oxo-2-propenyl)amino]-1-propanesulfonic acid is an organosulfonic acid. | | Solubility in organics | DMF, methanol (@ 65C), water |
| | 2-Acrylamide-2-methylpropanesulfonic acid Preparation Products And Raw materials |
|