|
|
| | Propanamide, N-(6,7-dihydro-6-oxo-1H-purin-2-yl)-2-methyl- Basic information |
| Product Name: | Propanamide, N-(6,7-dihydro-6-oxo-1H-purin-2-yl)-2-methyl- | | Synonyms: | N-(6,7-Dihydro-6-oxo-1H-purin-2-yl)-2-methylpropanamide;Propanamide, N-(6,7-dihydro-6-oxo-1H-purin-2-yl)-2-methyl-;N2-isobutyrylguanine (monohydrate);"PropanaMide, N-(6,9-dihydro-6-oxo-1H-purin-2-yl)-2-Methyl-;2-methyl-N-(6-oxo-3,7-dihydropurin-2-yl)propanamide,hydrate;N-(6-Oxo-6,7-dihydro-1H-purin-2-yl)isobutyraMide;N2- isobuttyryl guanine;2-N-isobutyrylguanine | | CAS: | 21047-89-2 | | MF: | C9H11N5O2 | | MW: | 221.22 | | EINECS: | | | Product Categories: | Naphthyridine,Quinoline | | Mol File: | 21047-89-2.mol |  |
| | Propanamide, N-(6,7-dihydro-6-oxo-1H-purin-2-yl)-2-methyl- Chemical Properties |
| Melting point | >300 °C | | density | 1.61±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 9.15±0.20(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C9H11N5O2/c1-4(2)7(15)13-9-12-6-5(8(16)14-9)10-3-11-6/h3-4H,1-2H3,(H3,10,11,12,13,14,15,16) | | InChIKey | CFIBTBBTJWHPQV-UHFFFAOYSA-N | | SMILES | C(NC1NC(=O)C2=C(N=1)NC=N2)(=O)C(C)C |
| | Propanamide, N-(6,7-dihydro-6-oxo-1H-purin-2-yl)-2-methyl- Usage And Synthesis |
| Uses | N-(6,7-Dihydro-6-oxo-1H-purin-2-yl)-2-methylpropanamide is applied in the enzymic transglycosylation of purine nucleobases in synthesis of purine nucleosides. |
| | Propanamide, N-(6,7-dihydro-6-oxo-1H-purin-2-yl)-2-methyl- Preparation Products And Raw materials |
|