| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
3,4-Difluoro-2-methylbenzonitrile manufacturers
|
| | 3,4-Difluoro-2-methylbenzonitrile Basic information |
| | 3,4-Difluoro-2-methylbenzonitrile Chemical Properties |
| Melting point | 39-44℃ | | Boiling point | 213.5±35.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | Colorless to off-white <40°C Solid,>48°C Liquid | | InChI | InChI=1S/C8H5F2N/c1-5-6(4-11)2-3-7(9)8(5)10/h2-3H,1H3 | | InChIKey | LMGHUTIUVKVZNH-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC=C(F)C(F)=C1C | | CAS DataBase Reference | 847502-83-4 |
| HazardClass | 6.1 | | HS Code | 2926907090 |
| | 3,4-Difluoro-2-methylbenzonitrile Usage And Synthesis |
| Uses | 3,4-Difluoro-2-methylbenzonitrile is a reactant used in the synthesis of chiral lactams. |
| | 3,4-Difluoro-2-methylbenzonitrile Preparation Products And Raw materials |
|