|
|
| | (S)-(-)-N-Benzyl-1-phenylethylamine Basic information |
| | (S)-(-)-N-Benzyl-1-phenylethylamine Chemical Properties |
| alpha | -39 º (neat) | | Boiling point | 171 °C15 mm Hg(lit.) | | density | 1.01 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.563(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 8.79±0.19(Predicted) | | form | Liquid | | color | Clear colorless to yellow | | Specific Gravity | 1.01 | | Optical Rotation | [α]19/D 40°, neat | | Sensitive | Air Sensitive | | BRN | 3650264 | | InChI | 1S/C15H17N/c1-13(15-10-6-3-7-11-15)16-12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3/t13-/m0/s1 | | InChIKey | ZYZHMSJNPCYUTB-ZDUSSCGKSA-N | | SMILES | C[C@H](NCc1ccccc1)c2ccccc2 | | CAS DataBase Reference | 17480-69-2(CAS DataBase Reference) | | NIST Chemistry Reference | (R)-(+)-n-benzyl-«alpha»-methylbenzylamine(17480-69-2) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36-37/39 | | RIDADR | 2735 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29214990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (S)-(-)-N-Benzyl-1-phenylethylamine Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | (S)-(?)-N-Benzyl-α-methylbenzylamine can be used:
- In one of the key synthetic steps for the preparation of a cardioprotective drug named CP-060S.
- To prepare (1S,2S,3S,5R)-tert-butyl 3-[benzyl((S)-1-phenylethyl)amino]-6,6-dimethylbicyclo[3.1.1]heptane-2-carboxylate, an intermediate used to synthesize pinane-based β- and γ-amino acids.
- To prepare urea derivatives as potent antimicrobial agents.
|
| | (S)-(-)-N-Benzyl-1-phenylethylamine Preparation Products And Raw materials |
|