|
|
| | (R)-(+)-N-Benzyl-1-phenylethylamine Basic information |
| | (R)-(+)-N-Benzyl-1-phenylethylamine Chemical Properties |
| Melting point | 111-114°C | | Boiling point | 171 °C15 mm Hg(lit.) | | alpha | 39 º (neat) | | density | 1.01 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.564(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform, DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.79±0.19(Predicted) | | color | Clear Colourless to Pale yellow | | Specific Gravity | 1.01 | | Optical Rotation | [α]20/D +38°, neat | | Sensitive | Air Sensitive | | BRN | 3589990 | | InChI | 1S/C15H17N/c1-13(15-10-6-3-7-11-15)16-12-14-8-4-2-5-9-14/h2-11,13,16H,12H2,1H3/t13-/m1/s1 | | InChIKey | ZYZHMSJNPCYUTB-CYBMUJFWSA-N | | SMILES | C[C@@H](NCc1ccccc1)c2ccccc2 | | CAS DataBase Reference | 38235-77-7(CAS DataBase Reference) | | NIST Chemistry Reference | (+)-N-benzyl-«alpha»-phenethylamine(38235-77-7) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-36/38-22 | | Safety Statements | 26-36-37/39 | | RIDADR | 2735 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29214990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | (R)-(+)-N-Benzyl-1-phenylethylamine Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | (R)-(+)-N-Benzyl-α-methylbenzylamine may be used to prepare:
- tert-Butyl (3S)-3-{benzyl[(1R)-1-phenylethyl]amino}-3-(6-methoxypyridin-3-yl)propanoate, an intermediate for the synthesis of the Merck & Co. Inc., Kenilworth, NJ, U.S. αvβ3 integrin antagonist.
- A conformationally restricted piperidine-based analog of deoxynegamycin.
- 5- and 6-[2,3]-dihydrobenzofuran β-amino acids, which can act as aspartic acid mimetics.
|
| | (R)-(+)-N-Benzyl-1-phenylethylamine Preparation Products And Raw materials |
|