| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | cis-1,2-Cyclooctanediol Basic information |
| Product Name: | cis-1,2-Cyclooctanediol | | Synonyms: | (1R)-Cyclooctane-1β,2β-diol;(1R,2S)-1,2-Cyclooctanediol;(1S)-Cyclooctane-1α,2α-diol;Cyclooctane-1α,2α-diol;Cyclooctane-1β,2β-diol;(1R,2S)-cyclooctane-1,2-diol;cis-1,2-Cyclooctanediol 99%;1,2-Cyclooctanediol, (1R,2S)-rel- | | CAS: | 27607-33-6 | | MF: | C8H16O2 | | MW: | 144.21 | | EINECS: | | | Product Categories: | Organic Building Blocks;Oxygen Compounds;Polyols | | Mol File: | 27607-33-6.mol |  |
| | cis-1,2-Cyclooctanediol Chemical Properties |
| Melting point | 78-80 °C (lit.) | | Boiling point | 264.6±8.0 °C(Predicted) | | density | 1.061±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 14.52±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1/C8H16O2/c9-7-5-3-1-2-4-6-8(7)10/h7-10H,1-6H2/t7-,8+ | | InChIKey | HUSOFJYAGDTKSK-OCAPTIKFNA-N | | SMILES | [C@@H]1(O)CCCCCC[C@@H]1O |&1:0,8,r| |
| Hazard Codes | Xi | | Risk Statements | 37/38-41 | | Safety Statements | 26-36/37-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Dam. 1
Skin Irrit. 2
STOT SE 3 |
| | cis-1,2-Cyclooctanediol Usage And Synthesis |
| Uses | cis-1,2-Cyclooctanediol may be used in the preparation of suberic acid. | | General Description | cis-1,2-Cyclooctanediol is a 1,2-disubstituted acyclic ethylene glycol. It undergoes cyclocondensation with oxalyl chloride in the presence of triethylamine at 0°C to yield cyclic oxalate. |
| | cis-1,2-Cyclooctanediol Preparation Products And Raw materials |
|