| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Lynnchem |
| Tel: |
86-(0)29-85992781 17792393971 |
| Email: |
info@lynnchem.com |
| Company Name: |
Novachemistry |
| Tel: |
44-20819178-90 02081917890 |
| Email: |
info@novachemistry.com |
|
| | (4-Methoxybenzyl)phosphonic acid Basic information |
| Product Name: | (4-Methoxybenzyl)phosphonic acid | | Synonyms: | (4-Methoxybenzyl)phosphonic acid, 98 %;(4-Methoxyphenyl)methylphosphonic acid;Phosphonic acid, [(4-methoxyphenyl)methyl]- (9CI);Phosphonic acid, [(4-methoxyphenyl)methyl]-;4-Methoxybenzylphosphonic acid;(4-Methoxybenzyl)phosphonic acid | | CAS: | 40299-61-4 | | MF: | C8H11O4P | | MW: | 202.14 | | EINECS: | | | Product Categories: | | | Mol File: | 40299-61-4.mol |  |
| | (4-Methoxybenzyl)phosphonic acid Chemical Properties |
| Melting point | 204-205 °C | | Boiling point | 415.4±47.0 °C(Predicted) | | density | 1.357±0.06 g/cm3(Predicted) | | pka | 2.31±0.10(Predicted) | | form | solid | | InChI | 1S/C8H11O4P/c1-12-8-4-2-7(3-5-8)6-13(9,10)11/h2-5H,6H2,1H3,(H2,9,10,11) | | InChIKey | XUAVFSMXCWTYNM-UHFFFAOYSA-N | | SMILES | OP(CC1=CC=C(OC)C=C1)(O)=O |
| WGK Germany | 3 | | HS Code | 2931499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | (4-Methoxybenzyl)phosphonic acid Usage And Synthesis |
| Uses | Tuning of surface energy, wetting, and work function of metal oxides. |
| | (4-Methoxybenzyl)phosphonic acid Preparation Products And Raw materials |
|